![]() |
Name |
2,6-Di-tert-butylhydroquinone
|
Molecular Formula | C14H22O2 | |
IUPAC Name* |
2,6-ditert-butylbenzene-1,4-diol
|
|
SMILES |
CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)O
|
|
InChI |
InChI=1S/C14H22O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,15-16H,1-6H3
|
|
InChIKey |
JFGVTUJBHHZRAB-UHFFFAOYSA-N
|
|
Synonyms |
2,6-Di-tert-butylhydroquinone; 2444-28-2; 2,6-di-tert-butylbenzene-1,4-diol; 1,4-Benzenediol, 2,6-bis(1,1-dimethylethyl)-; 2,6-ditert-butylbenzene-1,4-diol; 2,6-Di-tert-butyl-1,4-benzenediol; 2,6-Di-tert-butyl-hydroquinone; Hydroquinone, 2,6-di-tert-butyl-; RW7RBM89DC; 2,6-di-t-butylhydroquinone; 2,6-Di-tert-butyl-1,4-dihydroxybenzene; UNII-RW7RBM89DC; EINECS 219-481-5; 2,5-ditertbutylhydroquinone; Oprea1_865590; SCHEMBL39962; 2,6-di(t-butyl)hydroquinone; 3,5-Di-tert-butylhydroquinone; CHEMBL375695; GTPL5486; 2,6-di tert.butyl hydroquinone; 2,6-di-tert.butyl-hydroquinone; DTXSID5062423; CHEBI:174144; CAA44428; ZINC1841214; MFCD00458424; STK365476; AKOS005442455; 2,6-Ditert-butyl-1,4-benzenediol #; 2,6-DI-TERT-BUTYL-P-HYDROQUINONE; SY264943; 2,6-DI-TERT-BUTYLBENZOHYDROQUINONE; CS-0260246; 2,6-DI-TERT-BUTYL-1,4-HYDROQUINONE; 3,5-DI-TERT-BUTYL-1,4-HYDROQUINONE; 2,6-Bis(1,1-dimethylethyl)-1,4-Benzenediol; EN300-7472373; 2,6-Bis(1,1-dimethylethyl)-1,4-benzenediol, 9CI; Q27075212
|
|
CAS | 2444-28-2 | |
PubChem CID | 75550 | |
ChEMBL ID | CHEMBL375695 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.32 | ALogp: | 4.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.639 |
Caco-2 Permeability: | -5.004 | MDCK Permeability: | 0.00001280 |
Pgp-inhibitor: | 0.606 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.696 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 0.993 |
Blood-Brain-Barrier Penetration (BBB): | 0.334 | Plasma Protein Binding (PPB): | 97.41% |
Volume Distribution (VD): | 4.385 | Fu: | 5.44% |
CYP1A2-inhibitor: | 0.896 | CYP1A2-substrate: | 0.913 |
CYP2C19-inhibitor: | 0.479 | CYP2C19-substrate: | 0.53 |
CYP2C9-inhibitor: | 0.494 | CYP2C9-substrate: | 0.916 |
CYP2D6-inhibitor: | 0.874 | CYP2D6-substrate: | 0.884 |
CYP3A4-inhibitor: | 0.341 | CYP3A4-substrate: | 0.449 |
Clearance (CL): | 8.294 | Half-life (T1/2): | 0.766 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.018 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.13 | Maximum Recommended Daily Dose: | 0.845 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.904 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.751 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000610 | ![]() |
0.739 | D0H2DQ | ![]() |
0.387 | ||
ENC000708 | ![]() |
0.694 | D0W7WC | ![]() |
0.341 | ||
ENC000079 | ![]() |
0.667 | D0M8RC | ![]() |
0.323 | ||
ENC000346 | ![]() |
0.600 | D09EBS | ![]() |
0.319 | ||
ENC000611 | ![]() |
0.592 | D00NJL | ![]() |
0.268 | ||
ENC000658 | ![]() |
0.567 | D07EXH | ![]() |
0.255 | ||
ENC001398 | ![]() |
0.545 | D0Y4DY | ![]() |
0.254 | ||
ENC000695 | ![]() |
0.529 | D01JFT | ![]() |
0.250 | ||
ENC000185 | ![]() |
0.500 | D0X5NX | ![]() |
0.235 | ||
ENC000744 | ![]() |
0.500 | D0K5CB | ![]() |
0.232 |