![]() |
Name |
Methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate
|
Molecular Formula | C18H28O3 | |
IUPAC Name* |
methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate
|
|
SMILES |
CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OC
|
|
InChI |
InChI=1S/C18H28O3/c1-17(2,3)13-10-12(8-9-15(19)21-7)11-14(16(13)20)18(4,5)6/h10-11,20H,8-9H2,1-7H3
|
|
InChIKey |
PXMJCECEFTYEKE-UHFFFAOYSA-N
|
|
Synonyms |
6386-38-5; Methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate; methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate; Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, methyl ester; methyl di-t-butyl hydroxyhydrocinnamate; Methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate; Methyl 3,5-bis(tert-butyl)-4-hydroxyhydrocinnamate; 35RWF1ITXJ; Hydrocinnamic acid, 3,5-di-tert-butyl-4-hydroxy-, methyl ester; Methyl 3-[3,5-di(tert-butyl)-4-hydroxyphenyl]-propanoate; 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid methyl ester; MFCD00210461; methyl 3-[3,5-di(tert-butyl)-4-hydroxyphenyl]propanoate; Methyl 3,5-di-tert-butyl-4-hydroxyhydrocinnamate; methyl 3-(3',5'-di-tert-butyl-4'-hydroxyphenyl)propionate; Metilox; EINECS 228-985-4; UNII-35RWF1ITXJ; FENOZAN 1; EC 228-985-4; RALOX 35; PHENOSAN METHYL ESTER; Oprea1_220662; SCHEMBL490767; DTXSID7027623; CHEBI:183289; ZINC153450; BBL010671; STK801682; AKOS005071308; CS-W018869; DB-000294; FT-0614440; M1810; EN300-6477101; 386M385; 9R-0039; A834565; METHYL 3,5-DI-TERT-BUTYL-4-HYDROXYCINNAMATE; W-104870; methyl (3,5-di-tert-butyl-4-hydroxyphenyl)propionate; methyl 3-(3,5-di-t-butyl-4-hydroxyphenyl)-propionate; methyl 3-(3,5-di-t-butyl-4-hydroxyphenyl)propionate; methyl 3-[3,5-di(t-butyl)-4-hydroxyphenyl]propionate; METHYL DI-T-BUTYL HYDROXYHYDROCINNAMATE [INCI]; Q27256486; Z16642804; methyl 3-(3,5-ditert-butyl-4-oxidanyl-phenyl)propanoate; methyl3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate; 3-(3,5-Di-t-butyl-4-hydroxyphenyl) propionic methyl ester; methyl 3-(3',5'-di-t-butyl-4'-hydroxyphenyl)propionate; Methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate #; 3,5-Di-tert-butyl-4-hydroxybenzenepropionic acid methyl ester; 3,5-di-tert-butyl-4-hydroxyhydrocinnamic acid, methyl ester; methyl beta-(3,5-di-tert.-butyl-4-hydroxyphenyl)-propionate; 3-(3,5-di-t-butyl-4-hydroxyphenyl)-propionic acid methyl ester; 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionic acid methyl ester; 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid methyl ester; beta-(3,5-di-tert-butyl-4-hydroxyphenyl)propionic acid methyl ester; beta-(3,5-di-tert-butyl4-hydroxyphenyl)propionic acid methyl ester; METHYL .BETA.-(4-HYDROXY-3,5-DI-TERT-BUTYLPHENYL)PROPANOATE; METHYL .BETA.-(4-HYDROXY-3,5-DI-TERT-BUTYLPHENYL)PROPIONATE; METHYL .BETA.-3,5-DI-TERT-BUTYL-4-HYDROXYPHENYLPROPIONATE; METHYL 3,5-DI-TERT-BUTYL-4-HYDROXY-.BETA.-PHENYLPROPIONATE; BIS(1,1-DIMETHYLETHYL)-4-HYDROXY-BENZENEPROPANOIC ACID, METHYL ESTER, 3,5-
|
|
CAS | 6386-38-5 | |
PubChem CID | 62603 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 292.4 | ALogp: | 5.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.822 |
Caco-2 Permeability: | -5.175 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0.975 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.232 | 20% Bioavailability (F20%): | 0.995 |
30% Bioavailability (F30%): | 0.969 |
Blood-Brain-Barrier Penetration (BBB): | 0.753 | Plasma Protein Binding (PPB): | 98.00% |
Volume Distribution (VD): | 2.241 | Fu: | 3.64% |
CYP1A2-inhibitor: | 0.837 | CYP1A2-substrate: | 0.833 |
CYP2C19-inhibitor: | 0.704 | CYP2C19-substrate: | 0.798 |
CYP2C9-inhibitor: | 0.621 | CYP2C9-substrate: | 0.793 |
CYP2D6-inhibitor: | 0.806 | CYP2D6-substrate: | 0.651 |
CYP3A4-inhibitor: | 0.685 | CYP3A4-substrate: | 0.692 |
Clearance (CL): | 7.329 | Half-life (T1/2): | 0.633 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.124 |
Drug-inuced Liver Injury (DILI): | 0.049 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.104 | Maximum Recommended Daily Dose: | 0.313 |
Skin Sensitization: | 0.676 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.043 | Eye Irritation: | 0.52 |
Respiratory Toxicity: | 0.483 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000610 | ![]() |
0.593 | D0W7WC | ![]() |
0.333 | ||
ENC000725 | ![]() |
0.567 | D0H2DQ | ![]() |
0.324 | ||
ENC000708 | ![]() |
0.565 | D01JFT | ![]() |
0.293 | ||
ENC000346 | ![]() |
0.492 | D09EBS | ![]() |
0.280 | ||
ENC000079 | ![]() |
0.469 | D03XTC | ![]() |
0.273 | ||
ENC000611 | ![]() |
0.460 | D05CKR | ![]() |
0.259 | ||
ENC000504 | ![]() |
0.459 | D00NJL | ![]() |
0.255 | ||
ENC001398 | ![]() |
0.456 | D07XYV | ![]() |
0.245 | ||
ENC001382 | ![]() |
0.447 | D05VIX | ![]() |
0.244 | ||
ENC000294 | ![]() |
0.417 | D0Y6KO | ![]() |
0.235 |