![]() |
Name |
2,6-DI-Tert-butylphenol
|
Molecular Formula | C14H22O | |
IUPAC Name* |
2,6-ditert-butylphenol
|
|
SMILES |
CC(C)(C)C1=C(C(=CC=C1)C(C)(C)C)O
|
|
InChI |
InChI=1S/C14H22O/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6/h7-9,15H,1-6H3
|
|
InChIKey |
DKCPKDPYUFEZCP-UHFFFAOYSA-N
|
|
Synonyms |
2,6-DI-TERT-BUTYLPHENOL; 128-39-2; 2,6-Di-t-butylphenol; 2,6-Bis(tert-butyl)phenol; 2,6-ditert-butylphenol; Phenol, 2,6-bis(1,1-dimethylethyl)-; 2,6-Bis(1,1-dimethylethyl)phenol; 2,6 Di-tert-butylphenol; Ethanox 701; Isonox 103; Ethyl 701; Ethyl AN 701; Hitec 4701; 2,6-Di-tert-butyl-phenol; Phenol, 2,6-di-tert-butyl-; 2,6-Bis(t-butyl)phenol; AN 701; NSC 49175; 2,6-(1,1-Dimethylethyl)phenol; 2,6-di-tert.-butylphenol; CHEMBL281071; NSC-49175; 21294V58PF; 19126-15-9; DSSTox_CID_7052; DSSTox_RID_78295; DSSTox_GSID_27052; CAS-128-39-2; CCRIS 5828; HSDB 5616; EINECS 204-884-0; MFCD00008820; 2,6-di-tert-butyl phenol; AI3-26293; UNII-21294V58PF; 2,6-ditertbutylphenol; 2,6-di-t butylphenol; 2,6 ditert-butylphenol; 2,6-di-tertbutylphenol; 2,6-ditert.butylphenol; 2,6Di-tert-butylphenol; 2,6-di(t-butyl)phenol; 2,6-di-t-butyl phenol; 2,1-dimethylethyl)phenol; 2,6-Di- t-butylphenol; 2,6-ditert.-butylphenol; 2,6-di- tert-butylphenol; 2,6-di-tert.butyl-phenol; EC 204-884-0; 2,6-di-tert-butyl- phenol; 2,6-di-tert.-butyl phenol; 2,6-di-tert.-butyl-phenol; 2,6-di-tertiary butylphenol; SCHEMBL38598; Phenol, 2,6-bis(t-butyl); BIDD:ER0032; 2,6 -di-tert.-butyl phenol; 2,6-di-tertiary-butyl phenol; 2,6-Di-tert-butyl-4-phenol; 2,6-DTBP; DTXSID6027052; 2,6-Di-tert-butylhydroxybenzene; 2,6-Di-tert-butylphenol, 99%; CHEBI:131421; AMY40064; BCP25862; NSC49175; ZINC1681254; 2,6-di-(1,1-dimethylethyl)phenol; DI-TERT-BUTYLPHENOL, 2,6-; Tox21_200442; Tox21_300091; 2,6-bis (1,1-dimethylethyl)phenol; BDBM50240431; STL280177; AKOS009031587; 2,6-DI-TERT-BUTYLPHENOL [HSDB]; NCGC00164272-01; NCGC00164272-02; NCGC00164272-03; NCGC00254067-01; NCGC00257996-01; AC-14913; 1,3-DITERT.BUTYL,2-HYDROXY-BENZENE; D0941; FT-0610732; EN300-19647; A805816; Q2218184; W-108375; Z104474592; 2,6-(1,1-Dimethylethyl)phenol 2,6-bis(1,1-dimethylethyl)-pheno
|
|
CAS | 128-39-2 | |
PubChem CID | 31405 | |
ChEMBL ID | CHEMBL281071 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 206.32 | ALogp: | 4.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.656 |
Caco-2 Permeability: | -4.921 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.887 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.625 | 20% Bioavailability (F20%): | 0.963 |
30% Bioavailability (F30%): | 0.979 |
Blood-Brain-Barrier Penetration (BBB): | 0.294 | Plasma Protein Binding (PPB): | 99.20% |
Volume Distribution (VD): | 5.069 | Fu: | 3.93% |
CYP1A2-inhibitor: | 0.871 | CYP1A2-substrate: | 0.917 |
CYP2C19-inhibitor: | 0.6 | CYP2C19-substrate: | 0.837 |
CYP2C9-inhibitor: | 0.532 | CYP2C9-substrate: | 0.863 |
CYP2D6-inhibitor: | 0.791 | CYP2D6-substrate: | 0.813 |
CYP3A4-inhibitor: | 0.417 | CYP3A4-substrate: | 0.62 |
Clearance (CL): | 5.683 | Half-life (T1/2): | 0.271 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.022 |
Drug-inuced Liver Injury (DILI): | 0.024 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.168 | Maximum Recommended Daily Dose: | 0.163 |
Skin Sensitization: | 0.754 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.959 | Eye Irritation: | 0.978 |
Respiratory Toxicity: | 0.659 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000725 | ![]() |
0.592 | D0W7WC | ![]() |
0.365 | ||
ENC000610 | ![]() |
0.592 | D0H2DQ | ![]() |
0.309 | ||
ENC005113 | ![]() |
0.583 | D0A3HB | ![]() |
0.309 | ||
ENC000744 | ![]() |
0.583 | D01JFT | ![]() |
0.288 | ||
ENC000185 | ![]() |
0.583 | D06YPU | ![]() |
0.283 | ||
ENC000708 | ![]() |
0.558 | D00NJL | ![]() |
0.275 | ||
ENC000346 | ![]() |
0.529 | D09EBS | ![]() |
0.271 | ||
ENC000079 | ![]() |
0.529 | D0X4ZR | ![]() |
0.270 | ||
ENC000898 | ![]() |
0.510 | D02ZJI | ![]() |
0.258 | ||
ENC000695 | ![]() |
0.462 | D0K5CB | ![]() |
0.258 |