![]() |
Name |
2,5-Di-tert-butylphenol
|
Molecular Formula | C14H22O | |
IUPAC Name* |
2,5-ditert-butylphenol
|
|
SMILES |
CC(C)(C)C1=CC(=C(C=C1)C(C)(C)C)O
|
|
InChI |
InChI=1S/C14H22O/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9,15H,1-6H3
|
|
InChIKey |
KDBZVULQVCUNNA-UHFFFAOYSA-N
|
|
Synonyms |
2,5-Di-tert-butylphenol; 5875-45-6; 2,5-ditert-butylphenol; Phenol, 2,5-bis(1,1-dimethylethyl)-; Phenol, 2,5-di-tert-butyl-; 2,5-bis(1,1-Dimethylethyl)phenol; R9R0A277K1; NSC-68767; UNII-R9R0A277K1; NSC68767; EINECS 227-543-8; NSC 68767; 2,5-di-t-butyl phenol; 3,6-di-tert-butylphenol; NCIOpen2_003366; SCHEMBL142987; CHEMBL1795399; DTXSID0064046; CHEBI:143859; ZINC1695283; AKOS016347308; 2,5-DI-TERT-BUTYLHYDROXYBENZENE; CS-0364969; AG-672/25002578; Q27288018
|
|
CAS | 5875-45-6 | |
PubChem CID | 79983 | |
ChEMBL ID | CHEMBL1795399 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 206.32 | ALogp: | 4.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.656 |
Caco-2 Permeability: | -5.041 | MDCK Permeability: | 0.00001090 |
Pgp-inhibitor: | 0.612 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.717 | 20% Bioavailability (F20%): | 0.988 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.314 | Plasma Protein Binding (PPB): | 98.43% |
Volume Distribution (VD): | 4.735 | Fu: | 4.84% |
CYP1A2-inhibitor: | 0.937 | CYP1A2-substrate: | 0.931 |
CYP2C19-inhibitor: | 0.787 | CYP2C19-substrate: | 0.766 |
CYP2C9-inhibitor: | 0.685 | CYP2C9-substrate: | 0.877 |
CYP2D6-inhibitor: | 0.887 | CYP2D6-substrate: | 0.862 |
CYP3A4-inhibitor: | 0.484 | CYP3A4-substrate: | 0.67 |
Clearance (CL): | 6.094 | Half-life (T1/2): | 0.265 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.039 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.123 | Maximum Recommended Daily Dose: | 0.767 |
Skin Sensitization: | 0.699 | Carcinogencity: | 0.033 |
Eye Corrosion: | 0.976 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.708 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005113 | ![]() |
0.810 | D0W7WC | ![]() |
0.365 | ||
ENC000185 | ![]() |
0.810 | D06YPU | ![]() |
0.351 | ||
ENC000611 | ![]() |
0.583 | D00NJL | ![]() |
0.342 | ||
ENC000898 | ![]() |
0.574 | D01JFT | ![]() |
0.304 | ||
ENC000346 | ![]() |
0.560 | D02ZJI | ![]() |
0.297 | ||
ENC000079 | ![]() |
0.560 | D0K5CB | ![]() |
0.297 | ||
ENC000695 | ![]() |
0.551 | D06GIP | ![]() |
0.288 | ||
ENC001398 | ![]() |
0.509 | D02LTL | ![]() |
0.273 | ||
ENC000725 | ![]() |
0.500 | D09EBS | ![]() |
0.271 | ||
ENC000610 | ![]() |
0.500 | D0H2DQ | ![]() |
0.270 |