![]() |
Name |
2,4-Di-tert-butylphenol
|
Molecular Formula | C14H22O | |
IUPAC Name* |
2,4-ditert-butylphenol
|
|
SMILES |
CC(C)(C)C1=CC(=C(C=C1)O)C(C)(C)C
|
|
InChI |
InChI=1S/C14H22O/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9,15H,1-6H3
|
|
InChIKey |
ICKWICRCANNIBI-UHFFFAOYSA-N
|
|
Synonyms |
2,4-Di-tert-butylphenol; 96-76-4; Antioxidant No. 33; 2,4-DI-T-BUTYLPHENOL; Phenol, 2,4-bis(1,1-dimethylethyl)-; 1-Hydroxy-2,4-di-tert-butylbenzene; Prodox 146; 2,4-ditert-butylphenol; Phenol, 2,4-di-tert-butyl-; 2,4-bis(tert-butyl)phenol; Prodox 146A-85X; 2,4-Bis(1,1-dimethylethyl)phenol; 2,4-tert-butylphenol; MFCD00008828; NSC 174502; 2,4-ditert-butyl-phenol; FOB94G6HZT; 2,4-di-tert-butyl phenol; 2,4-Di-tert-butyl-phenol; 2,4-di~{tert}-butylphenol; CHEMBL29873; 2,4-Di-tert-butylhydroxybenzene; 2,4-Bis(1,1'-dimethylethyl)phenol; 2,4-bis(1,1-dimethylethyl)-phenol; NSC-174502; DSSTox_CID_6602; DSSTox_RID_78158; DSSTox_GSID_26602; CAS-96-76-4; EINECS 202-532-0; UNII-FOB94G6HZT; Phenol, 2,4-di(1,1-dimethylethyl)-; BRN 1910383; 2,4-DTBP; 2,4-ditertbutylphenol; 2,4-di-tertbutylphenol; 2,4di-tert-butylphenol; 2,4-di-t-butyl-phenol; 2,4-di-tert.butylphenol; 2,4-di-tertbutyl phenol; 2,4-ditert-butyl phenol; 2,4-ditertiarybutylphenol; Phenol,4-di-tert-butyl-; AGIDOL 10; EC 202-532-0; 2,4-Di-tert.-butylphenol; 2,4-ditertiary-butyl phenol; SCHEMBL109921; DTXSID2026602; CHEBI:89188; HSDB 8453; 2,4-Di-tert-butylphenol, 99%; 2,4-Di-tert-butylphenol-[d18]; BCP24012; ZINC1081075; Phenol,4-bis(1,1-dimethylethyl)-; Tox21_202320; Tox21_300114; BDBM50409544; NSC174502; Phenol,2,4-Bis(1,1-dimethylethyl); 1-Hydroxy-2, 4-di-tert-butylbenzene; AKOS003669719; CS-W015305; HY-W014589; NCGC00164059-01; NCGC00164059-02; NCGC00164059-03; NCGC00254167-01; NCGC00259869-01; AS-13983; 2,4-Ditert-butylphenol (ACD/Name 4.0); WLN: 1X1&1&R BQ CX1&1&1; D0229; FT-0610222; EN300-20927; E76999; A845633; Q-200191; Q26840829; 2,4-Di-tert-butylphenol 100 microg/mL in Acetonitrile; F0001-2302; (2S)-N-[(1S)-2-[[(1S)-2-[[(1S)-2-[[(1S)-2-[[2-[[(1S)-1-[[(1S)-4-amino-1-[(2S)-2-[(2-amino-2-oxo-ethyl)carbamoyl]pyrrolidine-1-carbonyl]-4-oxo-butyl]carbamoyl]-3-methyl-butyl]amino]-2-oxo-ethyl]amino]-1-[(4-hydroxyphenyl)methyl]-2-oxo-ethyl]amino]-1-(hydro; UGW
|
|
CAS | 96-76-4 | |
PubChem CID | 7311 | |
ChEMBL ID | CHEMBL29873 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 206.32 | ALogp: | 4.9 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.656 |
Caco-2 Permeability: | -5.048 | MDCK Permeability: | 0.00001070 |
Pgp-inhibitor: | 0.585 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.727 | 20% Bioavailability (F20%): | 0.989 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.294 | Plasma Protein Binding (PPB): | 98.43% |
Volume Distribution (VD): | 4.896 | Fu: | 4.95% |
CYP1A2-inhibitor: | 0.907 | CYP1A2-substrate: | 0.935 |
CYP2C19-inhibitor: | 0.77 | CYP2C19-substrate: | 0.779 |
CYP2C9-inhibitor: | 0.633 | CYP2C9-substrate: | 0.872 |
CYP2D6-inhibitor: | 0.885 | CYP2D6-substrate: | 0.864 |
CYP3A4-inhibitor: | 0.429 | CYP3A4-substrate: | 0.669 |
Clearance (CL): | 6.3 | Half-life (T1/2): | 0.324 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.041 |
Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.146 | Maximum Recommended Daily Dose: | 0.744 |
Skin Sensitization: | 0.739 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.983 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.699 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005113 | ![]() |
1.000 | D0W7WC | ![]() |
0.365 | ||
ENC000744 | ![]() |
0.810 | D00NJL | ![]() |
0.360 | ||
ENC000611 | ![]() |
0.583 | D06YPU | ![]() |
0.351 | ||
ENC000898 | ![]() |
0.574 | D02ZJI | ![]() |
0.317 | ||
ENC000500 | ![]() |
0.568 | D0K5CB | ![]() |
0.317 | ||
ENC000079 | ![]() |
0.560 | D01JFT | ![]() |
0.304 | ||
ENC000346 | ![]() |
0.560 | D06GIP | ![]() |
0.288 | ||
ENC000695 | ![]() |
0.551 | D0SS4P | ![]() |
0.277 | ||
ENC001398 | ![]() |
0.537 | D02LTL | ![]() |
0.273 | ||
ENC000610 | ![]() |
0.500 | D09EBS | ![]() |
0.271 |