|
Name |
Ocimene
|
| Molecular Formula | C10H16 | |
| IUPAC Name* |
3,7-dimethylocta-1,3,6-triene
|
|
| SMILES |
CC(=CCC=C(C)C=C)C
|
|
| InChI |
InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3
|
|
| InChIKey |
IHPKGUQCSIINRJ-UHFFFAOYSA-N
|
|
| Synonyms |
beta-Ocimene; 13877-91-3; 3,7-Dimethylocta-1,3,6-triene; OCIMENE; CHEBI:10436; 1,3,6-Octatriene,3,7-dimethyl-; (Z)-EC-OCIMENE; DSSTox_CID_27051; DSSTox_RID_82069; DSSTox_GSID_47051; beta-Ocimene (>90per cent); CHEMBL3187449; DTXSID70274135; 3,7-Dimethyl-1,3,6-octatrien; Tox21_302304; AKOS024319240; NCGC00256046-01; FT-0605370; E77940; Q27108635
|
|
| CAS | 13877-91-3 | |
| PubChem CID | 18756 | |
| ChEMBL ID | CHEMBL3187449 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 136.23 | ALogp: | 4.3 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
| Heavy Atoms: | 10 | QED Weighted: | 0.402 |
| Caco-2 Permeability: | -4.434 | MDCK Permeability: | 0.00002160 |
| Pgp-inhibitor: | 0.023 | Pgp-substrate: | 0.004 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.051 |
| 30% Bioavailability (F30%): | 0.075 |
| Blood-Brain-Barrier Penetration (BBB): | 0.9 | Plasma Protein Binding (PPB): | 87.26% |
| Volume Distribution (VD): | 4.122 | Fu: | 12.67% |
| CYP1A2-inhibitor: | 0.738 | CYP1A2-substrate: | 0.488 |
| CYP2C19-inhibitor: | 0.273 | CYP2C19-substrate: | 0.888 |
| CYP2C9-inhibitor: | 0.055 | CYP2C9-substrate: | 0.825 |
| CYP2D6-inhibitor: | 0.133 | CYP2D6-substrate: | 0.81 |
| CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.275 |
| Clearance (CL): | 14.171 | Half-life (T1/2): | 0.678 |
| hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.948 |
| Drug-inuced Liver Injury (DILI): | 0.029 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.043 | Maximum Recommended Daily Dose: | 0.368 |
| Skin Sensitization: | 0.951 | Carcinogencity: | 0.736 |
| Eye Corrosion: | 0.977 | Eye Irritation: | 0.99 |
| Respiratory Toxicity: | 0.889 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001568 | ![]() |
1.000 | D0M1PQ | ![]() |
0.268 | ||
| ENC001664 | ![]() |
0.610 | D0H6VY | ![]() |
0.240 | ||
| ENC001566 | ![]() |
0.500 | D05XQE | ![]() |
0.229 | ||
| ENC002306 | ![]() |
0.385 | D09XWD | ![]() |
0.213 | ||
| ENC001434 | ![]() |
0.375 | D0S7WX | ![]() |
0.186 | ||
| ENC001718 | ![]() |
0.368 | D03VFL | ![]() |
0.182 | ||
| ENC001641 | ![]() |
0.367 | D0F1GS | ![]() |
0.162 | ||
| ENC000314 | ![]() |
0.360 | D0Z4NI | ![]() |
0.162 | ||
| ENC001649 | ![]() |
0.356 | D0Q6DX | ![]() |
0.161 | ||
| ENC001735 | ![]() |
0.350 | D06BLQ | ![]() |
0.157 | ||