|
Name |
Neryl formate
|
| Molecular Formula | C11H18O2 | |
| IUPAC Name* |
[(2Z)-3,7-dimethylocta-2,6-dienyl] formate
|
|
| SMILES |
CC(=CCC/C(=C\COC=O)/C)C
|
|
| InChI |
InChI=1S/C11H18O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7,9H,4,6,8H2,1-3H3/b11-7-
|
|
| InChIKey |
FQMZVFJYMPNUCT-XFFZJAGNSA-N
|
|
| Synonyms |
Neryl formate; 2142-94-1; Formic acid, neryl ester; [(2Z)-3,7-dimethylocta-2,6-dienyl] formate; (Z)-3,7-Dimethyl-2,6-octadienyl formate; FEMA No. 2776; I0Z8J413XD; 2,6-OCTADIEN-1-OL, 3,7-DIMETHYL-, FORMATE, (Z)-; WE(8:2(2Z,6E)(3Me,7Me)/1:0); 2,6-Octadien-1-ol, 3,7-dimethyl-, formate, (2Z)-; ((2Z)-3,7-DIMETHYLOCTA-2,6-DIENYL) FORMATE; Neryl methanoate; NSC-21736; (2E)-3,7-Dimethyl-2,6-octadienyl formate; Neryl 2-methylpropanoate; Neryl formate (natural); trans-3,7-Dimethyl-2,6-octadien-1-yl methanoate; (2E)-3,7-dimethyl-2,6-octadien-1-ol, 1-formate; UNII-I0Z8J413XD; NERYL FORMATE [FHFI]; SCHEMBL2822047; FEMA 2514; DTXSID701014544; trans-3,6-octadien-1-ol formate; trans-3,6-octadien-1-yl formate; NSC21736; EINECS 218-401-6; LMFA07010623; ZINC15120477; AKOS006229075; WLN: VHO2UY1&3UY1&1 -T; 2, 3,7-dimethyl-, formate, (E)-; 3,7-Dimethyl-2,6-octadien-1-ol, formate; 3,7-Dimethyl-2,6-octadienyl formate, (Z)-; 3,7-Dimethyl-formate(E)-2,6-Octadien-1-ol; cis-3,7-Dimethyl-2,6-octadien-1-ol formate; 3,7-Dimethyl-formate(2E)-2,6-Octadien-1-ol; (2Z)-3,7-dimethylocta-2,6-dien-1-yl formate; 3,7-Dimethyl-2,6-octadien-1-yl formate, cis-; trans-3, 7-Dimethyl-2,6-octadien-1-yl formate; 3,7-Dimethyl-1-formate(2E)-2,6-Octadien-1-ol; 3,7-Dimethyl-2,6-octadien-1-yl methanoate, cis-; 3,7-Dimethyl-2,6-octadienyl ester(E)-Formic acid; formic acid 3,7-dimethyl-octa-2cis,6-dienyl ester; Formic acid,7-dimethyl-2,6-octadienyl ester, (E)-; CIS-3,7- DIMETHYL-2,6-OCTADIEN-1-OL FORMATE; (Z)-3,7- DIMETHYL-2,6-OCTADIEN-1-YL FORMATE; 2,6-Octadien-1-ol, 3,7-dimethyl-, 1-formate, (2Z)-
|
|
| CAS | 2142-94-1 | |
| PubChem CID | 5354882 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 182.26 | ALogp: | 3.5 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 13 | QED Weighted: | 0.356 |
| Caco-2 Permeability: | -4.524 | MDCK Permeability: | 0.00001950 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.007 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.623 |
| 30% Bioavailability (F30%): | 0.642 |
| Blood-Brain-Barrier Penetration (BBB): | 0.998 | Plasma Protein Binding (PPB): | 80.16% |
| Volume Distribution (VD): | 2.094 | Fu: | 11.68% |
| CYP1A2-inhibitor: | 0.914 | CYP1A2-substrate: | 0.274 |
| CYP2C19-inhibitor: | 0.492 | CYP2C19-substrate: | 0.688 |
| CYP2C9-inhibitor: | 0.125 | CYP2C9-substrate: | 0.69 |
| CYP2D6-inhibitor: | 0.247 | CYP2D6-substrate: | 0.445 |
| CYP3A4-inhibitor: | 0.09 | CYP3A4-substrate: | 0.249 |
| Clearance (CL): | 9.423 | Half-life (T1/2): | 0.895 |
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.855 |
| Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.026 |
| Skin Sensitization: | 0.916 | Carcinogencity: | 0.549 |
| Eye Corrosion: | 0.11 | Eye Irritation: | 0.827 |
| Respiratory Toxicity: | 0.05 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001424 | ![]() |
0.600 | D05XQE | ![]() |
0.357 | ||
| ENC001434 | ![]() |
0.600 | D09XWD | ![]() |
0.351 | ||
| ENC001467 | ![]() |
0.532 | D0M1PQ | ![]() |
0.298 | ||
| ENC001717 | ![]() |
0.529 | D03VFL | ![]() |
0.284 | ||
| ENC002413 | ![]() |
0.529 | D06BLQ | ![]() |
0.198 | ||
| ENC001718 | ![]() |
0.525 | D0Q6DX | ![]() |
0.194 | ||
| ENC001464 | ![]() |
0.509 | D03ZFG | ![]() |
0.179 | ||
| ENC001720 | ![]() |
0.500 | D0Q9HF | ![]() |
0.176 | ||
| ENC001664 | ![]() |
0.500 | D0X7XG | ![]() |
0.175 | ||
| ENC001719 | ![]() |
0.500 | D0OL6O | ![]() |
0.173 | ||