![]() |
Name |
2,6-Octadiene, 2,6-dimethyl-
|
Molecular Formula | C10H18 | |
IUPAC Name* |
(6E)-2,6-dimethylocta-2,6-diene
|
|
SMILES |
C/C=C(\C)/CCC=C(C)C
|
|
InChI |
InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,7H,6,8H2,1-4H3/b10-5+
|
|
InChIKey |
MZPDTOMKQCMETI-BJMVGYQFSA-N
|
|
Synonyms |
2609-23-6; 2,6-Octadiene, 2,6-dimethyl-; (6E)-2,6-dimethylocta-2,6-diene; 2792-39-4; 2,6-Dimethyl-2-cis-6-octadiene; 2,6-Dimethyl-trans-2,6-octadiene; 2,6-DIMETHYL-2,6-OCTADIENE; (6E)-2,6-Dimethyl-2,6-octadiene; 2,6-Dimethyl-2-trans-6-octadiene; (6Z)-2,6-Dimethyl-2,6-octadiene; NSC310168; 2,6-Dimethyl 2,6-octadiene; DTXSID401015874; 2,6-dimethyl-octa-2,6trans-diene; ZINC1569111; (E)-2,6-Dimethyl-2,6-octadiene; 2,6-Dimethyl 2,6-octadiene (cis); (6E)-2,6-dimethyl-octa-2,6-diene; NSC-310168; (6Z)-2,6-Dimethyl-2,6-octadiene #; [(2E)-3,7-Dimethyl-2,6-octadienyl]
|
|
CAS | 2792-39-4 | |
PubChem CID | 5365898 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 138.25 | ALogp: | 4.1 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.507 |
Caco-2 Permeability: | -4.414 | MDCK Permeability: | 0.00002160 |
Pgp-inhibitor: | 0.172 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.866 |
30% Bioavailability (F30%): | 0.46 |
Blood-Brain-Barrier Penetration (BBB): | 0.814 | Plasma Protein Binding (PPB): | 98.05% |
Volume Distribution (VD): | 3.868 | Fu: | 4.28% |
CYP1A2-inhibitor: | 0.942 | CYP1A2-substrate: | 0.479 |
CYP2C19-inhibitor: | 0.398 | CYP2C19-substrate: | 0.767 |
CYP2C9-inhibitor: | 0.158 | CYP2C9-substrate: | 0.833 |
CYP2D6-inhibitor: | 0.19 | CYP2D6-substrate: | 0.202 |
CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.203 |
Clearance (CL): | 12.566 | Half-life (T1/2): | 0.381 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.684 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.059 |
Skin Sensitization: | 0.741 | Carcinogencity: | 0.045 |
Eye Corrosion: | 0.967 | Eye Irritation: | 0.987 |
Respiratory Toxicity: | 0.037 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001424 | ![]() |
0.618 | D0M1PQ | ![]() |
0.405 | ||
ENC001434 | ![]() |
0.618 | D05XQE | ![]() |
0.344 | ||
ENC001720 | ![]() |
0.579 | D09XWD | ![]() |
0.319 | ||
ENC001719 | ![]() |
0.579 | D03VFL | ![]() |
0.268 | ||
ENC001467 | ![]() |
0.537 | D0Q9HF | ![]() |
0.186 | ||
ENC001649 | ![]() |
0.525 | D0Q6DX | ![]() |
0.182 | ||
ENC001564 | ![]() |
0.500 | D0X7XG | ![]() |
0.179 | ||
ENC001664 | ![]() |
0.500 | D0S7WX | ![]() |
0.169 | ||
ENC001606 | ![]() |
0.478 | D0W6DG | ![]() |
0.167 | ||
ENC000314 | ![]() |
0.478 | D03ZFG | ![]() |
0.167 |