![]() |
Name |
(Z)-alpha-Bisabolene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
1-methyl-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclohexene
|
|
SMILES |
CC1=CCC(CC1)/C(=C\CC=C(C)C)/C
|
|
InChI |
InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6-8,15H,5,9-11H2,1-4H3/b14-7-
|
|
InChIKey |
YHBUQBJHSRGZNF-AUWJEWJLSA-N
|
|
Synonyms |
(Z)-alpha-Bisabolene; alpha-Bisabolene; cis-alpha-Bisabolene; cis-.alpha.-Bisabolene; (E)-.alpha.-bisabolene; 29837-07-8; .alpha.-Bisabolene; 1,8,12-Bisabolatriene; 2,5-Heptadiene, 2-methyl-6-(4-methyl-3-cyclohexen-1-yl)-, (Z)-; 4-[(1Z)-1,5-Dimethyl-1,4-hexadienyl]-1-methyl-1-cyclohexene; Cyclohexene, 4-((1Z)-1,5-dimethyl-1,4-hexadien-1-yl)-1-methyl-; 6-Methyl-2-(4-methylcyclohex-3-enyl)hept-2,5-diene; 17627-44-0; (9Z)-bisabola-4,7(11),9-triene 4-[(1Z)-1,5-dimethylhexa-1,4-dien-1-yl]-1-methylcyclohexene; trans-.alpha.-Bisabolene; (Z)-.alpha.-Bisabolene; bisabola-4,7(11),9-triene; Cyclohexene, 4-(1,5-dimethyl-1,4-hexadienyl)-1-methyl-, (Z)-; Cyclohexene, 4-[(1Z)-1,5-dimethyl-1,4-hexadien-1-yl]-1-methyl-; a-Limene; a-Bisabolene?; .alpha.-Bisabolene (Z); 2,7,10-Bisabolatriene; 4-(1,5-dimethylhexa-1,4-dien-1-yl)-1-methylcyclohexene; 2,5-Heptadiene, 2-methyl-6-(4-methyl-3-cyclohexen-1-yl)-, (E)-; CHEBI:49241; FEMA 3331; DTXSID601037278; (9Z)-bisabola-4,7(11),9-triene; LMPR0103060006; Q27121555; 4-(1,5-Dimethyl-1,4-hexadienyl)-1-methyl-cyclohexene; 1-methyl-4-(1,5-dimethyl-(z)-1,4-hexadienyl)-cyclohexene; 1-Methyl-4-(6-methylhepta-2,5-dien-2-yl)cyclohex-1-ene; 4-(1,5-Dimethyl-1,4-hexadien-1-yl)-1-methyl-Cyclohexene; 4-(1,5-Dimethyl-1,4-hexadienyl)-1-methylcyclohexene, 9CI; 4-[(1Z)-1,5-dimethyl-hexa-1,4-dienyl]-1-methyl-cyclohexene; 4-((1Z)-1,5-Dimethyl-1,4-hexadien-1-yl)-1-methyl-cyclohexene; 4-[(1E)-1,5-Dimethyl-1,4-hexadienyl]-1-methyl-1-cyclohexene; 4-[(1Z)-1,5-dimethylhexa-1,4-dien-1-yl]-1-methylcyclohexene; Cyclohexene, 4-[(1E)-1,5-dimethyl-1,4-hexadienyl]-1-methyl-
|
|
CAS | 29837-07-8 | |
PubChem CID | 5352653 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 5.2 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.542 |
Caco-2 Permeability: | -4.486 | MDCK Permeability: | 0.00001910 |
Pgp-inhibitor: | 0.139 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.952 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.403 | Plasma Protein Binding (PPB): | 98.79% |
Volume Distribution (VD): | 5.403 | Fu: | 1.83% |
CYP1A2-inhibitor: | 0.901 | CYP1A2-substrate: | 0.441 |
CYP2C19-inhibitor: | 0.588 | CYP2C19-substrate: | 0.756 |
CYP2C9-inhibitor: | 0.456 | CYP2C9-substrate: | 0.884 |
CYP2D6-inhibitor: | 0.28 | CYP2D6-substrate: | 0.738 |
CYP3A4-inhibitor: | 0.342 | CYP3A4-substrate: | 0.24 |
Clearance (CL): | 16.173 | Half-life (T1/2): | 0.254 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.93 |
Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.12 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.842 |
Eye Corrosion: | 0.349 | Eye Irritation: | 0.952 |
Respiratory Toxicity: | 0.346 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001981 | ![]() |
0.577 | D0S7WX | ![]() |
0.225 | ||
ENC001066 | ![]() |
0.478 | D0W6DG | ![]() |
0.222 | ||
ENC000555 | ![]() |
0.478 | D0M1PQ | ![]() |
0.218 | ||
ENC001455 | ![]() |
0.474 | D03VFL | ![]() |
0.214 | ||
ENC001812 | ![]() |
0.460 | D0G3PI | ![]() |
0.190 | ||
ENC002339 | ![]() |
0.441 | D02DGU | ![]() |
0.190 | ||
ENC001484 | ![]() |
0.414 | D00DKK | ![]() |
0.190 | ||
ENC003092 | ![]() |
0.393 | D05XQE | ![]() |
0.188 | ||
ENC003150 | ![]() |
0.377 | D0O1UZ | ![]() |
0.182 | ||
ENC001568 | ![]() |
0.367 | D09XWD | ![]() |
0.178 |