|
Name |
Diphenyl disulfide
|
| Molecular Formula | C12H10S2 | |
| IUPAC Name* |
(phenyldisulfanyl)benzene
|
|
| SMILES |
C1=CC=C(C=C1)SSC2=CC=CC=C2
|
|
| InChI |
InChI=1S/C12H10S2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H
|
|
| InChIKey |
GUUVPOWQJOLRAS-UHFFFAOYSA-N
|
|
| Synonyms |
DIPHENYL DISULFIDE; Phenyl disulfide; 882-33-7; 1,2-diphenyldisulfane; Disulfide, diphenyl; (Phenyldisulfanyl)benzene; diphenyldisulfide; Diphenyl disulphide; Biphenyl disulfide; Phenyldithiobenzene; Disulfide diphenyl; USAF E-1; 1,1'-dithiodibenzene; FEMA No. 3225; Phenyldisulfide; phenyl disulphide; diphenyldisulphide; MLS000069663; CHEMBL462861; NSC2689; 7P54H519IJ; NSC-2689; SMR000059177; 93345-44-9; NSC 2689; EINECS 212-926-4; MFCD00003065; 1,1'-disulfanediyldibenzene; phenyidisulfide; phenyldisulphide; Dithiobisbenzene; UNII-7P54H519IJ; diphenyidisulfide; phenyl-disulfide; AI3-02911; PhSSPh; Diphenyl persulfide; phenyldisulfanylbenzene; bis-(phenyl)disulfide; phenyldisulfanyl-benzene; (phenyldisulanyl)benzene; Phenyl disulfide, 8CI; Ph-S-S-Ph; Opera_ID_773; Phenyl disulfide, 99%; WLN: RSSR; DSSTox_CID_2131; (Phenyldisulfanyl)benzene #; SCHEMBL5148; Phenyl disulfide, >=98%; DSSTox_RID_76501; DSSTox_GSID_22131; DIPHENYL DISULFIDE [MI]; DTXSID6022131; FEMA 3225; DIPHENYL DISULFIDE [FHFI]; CHEBI:174102; HMS2235I05; HY-Y1177; STR01628; ZINC1641089; Tox21_200728; BDBM50450778; NSC799311; Phenyl disulfide, analytical standard; STL182756; AKOS000120953; NSC-799311; NCGC00093353-02; NCGC00258282-01; CAS-882-33-7; DB-011816; CS-0017165; P0167; EN300-20703; D72521; A842506; Diphenyl disulfide, technical, >=97.0% (HPLC); J-520380; Q2423101; F0001-2477; Z104480056; ENVIRONMENTALLY HAZARDOUS SUBSTANCE, SOLID, N.O.S. (DIPHENYL DISULPHIDE)
|
|
| CAS | 882-33-7 | |
| PubChem CID | 13436 | |
| ChEMBL ID | CHEMBL462861 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 218.3 | ALogp: | 4.4 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 50.6 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.666 |
| Caco-2 Permeability: | -4.225 | MDCK Permeability: | 0.00001780 |
| Pgp-inhibitor: | 0.027 | Pgp-substrate: | 0.072 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.925 |
| Blood-Brain-Barrier Penetration (BBB): | 0.824 | Plasma Protein Binding (PPB): | 96.18% |
| Volume Distribution (VD): | 1.389 | Fu: | 4.13% |
| CYP1A2-inhibitor: | 0.964 | CYP1A2-substrate: | 0.731 |
| CYP2C19-inhibitor: | 0.986 | CYP2C19-substrate: | 0.143 |
| CYP2C9-inhibitor: | 0.967 | CYP2C9-substrate: | 0.266 |
| CYP2D6-inhibitor: | 0.051 | CYP2D6-substrate: | 0.094 |
| CYP3A4-inhibitor: | 0.039 | CYP3A4-substrate: | 0.569 |
| Clearance (CL): | 11.886 | Half-life (T1/2): | 0.112 |
| hERG Blockers: | 0.367 | Human Hepatotoxicity (H-HT): | 0.107 |
| Drug-inuced Liver Injury (DILI): | 0.943 | AMES Toxicity: | 0.905 |
| Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.03 |
| Skin Sensitization: | 0.956 | Carcinogencity: | 0.422 |
| Eye Corrosion: | 0.939 | Eye Irritation: | 0.995 |
| Respiratory Toxicity: | 0.984 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000093 | ![]() |
0.509 | D0G1VX | ![]() |
0.459 | ||
| ENC000295 | ![]() |
0.467 | D0T5UL | ![]() |
0.424 | ||
| ENC000077 | ![]() |
0.459 | D04DXN | ![]() |
0.424 | ||
| ENC000047 | ![]() |
0.440 | D07HQC | ![]() |
0.412 | ||
| ENC001523 | ![]() |
0.418 | D0J5RN | ![]() |
0.412 | ||
| ENC001050 | ![]() |
0.418 | D01FGR | ![]() |
0.406 | ||
| ENC000732 | ![]() |
0.413 | D0E4DW | ![]() |
0.406 | ||
| ENC000321 | ![]() |
0.412 | D0B1FE | ![]() |
0.391 | ||
| ENC001449 | ![]() |
0.406 | D08HRJ | ![]() |
0.384 | ||
| ENC001737 | ![]() |
0.400 | D0W2AN | ![]() |
0.384 | ||