|
Name |
asperlention E
|
| Molecular Formula | C35H34O15 | |
| IUPAC Name* |
methyl4-acetyloxy-1,8-dihydroxy-5-[5-hydroxy-2-(2-methoxy-2-oxoethyl)-7-methyl-4-oxo-2-(5-oxooxolan-2-yl)-3H-chromen-6-yl]-3-methyl-9-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
| SMILES |
COC(=O)CC1(C2CCC(=O)O2)CC(=O)c2c(cc(C)c(-c3ccc(O)c4c3OC3(C(=O)OC)C(=C(O)CC(C)C3OC(C)=O)C4=O)c2O)O1
|
|
| InChI |
InChI=1S/C35H34O15/c1-14-11-21-26(20(39)12-34(49-21,13-24(41)45-4)22-8-9-23(40)48-22)29(42)25(14)17-6-7-18(37)27-30(43)28-19(38)10-15(2)32(47-16(3)36)35(28,33(44)46-5)50-31(17)27/h6-7,11,15,22,32,37-38,42H,8-10,12-13H2,1-5H3/t15-,22-,32-,34?,35+/m0/s1
|
|
| InChIKey |
DTOZRJBHYVTXIV-YCXRYJPASA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 694.64 | ALogp: | 3.3 |
| HBD: | 3 | HBA: | 15 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 218.5 | Aromatic Rings: | 6 |
| Heavy Atoms: | 50 | QED Weighted: | 0.287 |
| Caco-2 Permeability: | -5.203 | MDCK Permeability: | 0.00003110 |
| Pgp-inhibitor: | 0.835 | Pgp-substrate: | 0.581 |
| Human Intestinal Absorption (HIA): | 0.837 | 20% Bioavailability (F20%): | 0.015 |
| 30% Bioavailability (F30%): | 0.924 |
| Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 84.13% |
| Volume Distribution (VD): | 0.45 | Fu: | 6.61% |
| CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.133 |
| CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.066 |
| CYP2C9-inhibitor: | 0.151 | CYP2C9-substrate: | 0.443 |
| CYP2D6-inhibitor: | 0.077 | CYP2D6-substrate: | 0.134 |
| CYP3A4-inhibitor: | 0.757 | CYP3A4-substrate: | 0.391 |
| Clearance (CL): | 4.098 | Half-life (T1/2): | 0.045 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.88 |
| Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.969 | Maximum Recommended Daily Dose: | 0.47 |
| Skin Sensitization: | 0.015 | Carcinogencity: | 0.03 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.02 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006113 | ![]() |
0.868 | D07IPB | ![]() |
0.274 | ||
| ENC006117 | ![]() |
0.737 | D01UBX | ![]() |
0.272 | ||
| ENC006115 | ![]() |
0.706 | D01XWG | ![]() |
0.271 | ||
| ENC006116 | ![]() |
0.696 | D0T5XN | ![]() |
0.264 | ||
| ENC005730 | ![]() |
0.506 | D0Q0PR | ![]() |
0.262 | ||
| ENC005885 | ![]() |
0.483 | D0T8EH | ![]() |
0.261 | ||
| ENC003348 | ![]() |
0.483 | D07VLY | ![]() |
0.260 | ||
| ENC005069 | ![]() |
0.480 | D0C9XJ | ![]() |
0.260 | ||
| ENC003346 | ![]() |
0.472 | D03RTK | ![]() |
0.253 | ||
| ENC005727 | ![]() |
0.470 | D0FX2Q | ![]() |
0.251 | ||