|
Name |
asperlention F
|
| Molecular Formula | C35H36O16 | |
| IUPAC Name* |
methyl4-acetyloxy-1,8-dihydroxy-5-[5-hydroxy-2-(1-hydroxy-4-methoxy-4-oxobutyl)-2-methoxycarbonyl-7-methyl-4-oxo-3H-chromen-6-yl]-3-methyl-9-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
| SMILES |
COC(=O)CCC(O)C1(C(=O)OC)CC(=O)c2c(cc(C)c(-c3ccc(O)c4c3OC3(C(=O)OC)C(=C(O)CC(C)C3OC(C)=O)C4=O)c2O)O1
|
|
| InChI |
InChI=1S/C35H36O16/c1-14-12-21-25(20(39)13-34(50-21,32(44)47-5)22(40)9-10-23(41)46-4)28(42)24(14)17-7-8-18(37)26-29(43)27-19(38)11-15(2)31(49-16(3)36)35(27,33(45)48-6)51-30(17)26/h7-8,12,15,22,31,37-38,40,42H,9-11,13H2,1-6H3/t15-,22+,31-,34+,35+/m0/s1
|
|
| InChIKey |
HNUTWILXWHPIEI-WRHUEMQVSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 712.66 | ALogp: | 2.5 |
| HBD: | 4 | HBA: | 16 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 238.7 | Aromatic Rings: | 5 |
| Heavy Atoms: | 51 | QED Weighted: | 0.227 |
| Caco-2 Permeability: | -5.359 | MDCK Permeability: | 0.00001920 |
| Pgp-inhibitor: | 0.763 | Pgp-substrate: | 0.847 |
| Human Intestinal Absorption (HIA): | 0.921 | 20% Bioavailability (F20%): | 0.031 |
| 30% Bioavailability (F30%): | 0.964 |
| Blood-Brain-Barrier Penetration (BBB): | 0.025 | Plasma Protein Binding (PPB): | 83.42% |
| Volume Distribution (VD): | 0.657 | Fu: | 9.14% |
| CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.479 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.098 |
| CYP2C9-inhibitor: | 0.076 | CYP2C9-substrate: | 0.235 |
| CYP2D6-inhibitor: | 0.026 | CYP2D6-substrate: | 0.134 |
| CYP3A4-inhibitor: | 0.787 | CYP3A4-substrate: | 0.558 |
| Clearance (CL): | 5.877 | Half-life (T1/2): | 0.039 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.87 |
| Drug-inuced Liver Injury (DILI): | 0.962 | AMES Toxicity: | 0.023 |
| Rat Oral Acute Toxicity: | 0.969 | Maximum Recommended Daily Dose: | 0.441 |
| Skin Sensitization: | 0.009 | Carcinogencity: | 0.026 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.015 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006113 | ![]() |
0.709 | D07IPB | ![]() |
0.279 | ||
| ENC006114 | ![]() |
0.706 | D0T5XN | ![]() |
0.269 | ||
| ENC006116 | ![]() |
0.671 | D01XWG | ![]() |
0.263 | ||
| ENC006117 | ![]() |
0.669 | D0Q0PR | ![]() |
0.261 | ||
| ENC005730 | ![]() |
0.583 | D0FX2Q | ![]() |
0.256 | ||
| ENC003346 | ![]() |
0.565 | D07VLY | ![]() |
0.253 | ||
| ENC003347 | ![]() |
0.511 | D0C9XJ | ![]() |
0.253 | ||
| ENC005727 | ![]() |
0.508 | D01UBX | ![]() |
0.249 | ||
| ENC005728 | ![]() |
0.497 | D0T8EH | ![]() |
0.242 | ||
| ENC005729 | ![]() |
0.492 | D05CHI | ![]() |
0.238 | ||