![]() |
Name |
asperlention D
|
Molecular Formula | C34H32O15 | |
IUPAC Name* |
methyl4-acetyloxy-1,8-dihydroxy-5-[5-hydroxy-2-methoxycarbonyl-7-methyl-4-oxo-2-(5-oxooxolan-2-yl)-3H-chromen-6-yl]-3-methyl-9-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
COC(=O)C1(C2CCC(=O)O2)CC(=O)c2c(cc(C)c(-c3ccc(O)c4c3OC3(C(=O)OC)C(=C(O)CC(C)C3OC(C)=O)C4=O)c2O)O1
|
|
InChI |
InChI=1S/C34H32O15/c1-13-11-20-24(19(38)12-33(48-20,31(42)44-4)21-8-9-22(39)47-21)27(40)23(13)16-6-7-17(36)25-28(41)26-18(37)10-14(2)30(46-15(3)35)34(26,32(43)45-5)49-29(16)25/h6-7,11,14,21,30,36-37,40H,8-10,12H2,1-5H3/t14-,21-,30-,33?,34+/m0/s1
|
|
InChIKey |
WAVXQOUDBSYDAC-YAZPYZJBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 680.62 | ALogp: | 2.9 |
HBD: | 3 | HBA: | 15 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 218.5 | Aromatic Rings: | 6 |
Heavy Atoms: | 49 | QED Weighted: | 0.303 |
Caco-2 Permeability: | -5.2 | MDCK Permeability: | 0.00003080 |
Pgp-inhibitor: | 0.896 | Pgp-substrate: | 0.251 |
Human Intestinal Absorption (HIA): | 0.746 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.888 |
Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 87.43% |
Volume Distribution (VD): | 0.563 | Fu: | 5.66% |
CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.313 |
CYP2C19-inhibitor: | 0.053 | CYP2C19-substrate: | 0.071 |
CYP2C9-inhibitor: | 0.152 | CYP2C9-substrate: | 0.417 |
CYP2D6-inhibitor: | 0.07 | CYP2D6-substrate: | 0.148 |
CYP3A4-inhibitor: | 0.766 | CYP3A4-substrate: | 0.51 |
Clearance (CL): | 3.568 | Half-life (T1/2): | 0.025 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.878 |
Drug-inuced Liver Injury (DILI): | 0.969 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.971 | Maximum Recommended Daily Dose: | 0.371 |
Skin Sensitization: | 0.016 | Carcinogencity: | 0.042 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.012 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006114 | ![]() |
0.868 | D01XWG | ![]() |
0.276 | ||
ENC006116 | ![]() |
0.732 | D01UBX | ![]() |
0.270 | ||
ENC006115 | ![]() |
0.709 | D07IPB | ![]() |
0.266 | ||
ENC006117 | ![]() |
0.696 | D0T5XN | ![]() |
0.262 | ||
ENC005885 | ![]() |
0.545 | D0Q0PR | ![]() |
0.260 | ||
ENC003348 | ![]() |
0.545 | D0T8EH | ![]() |
0.259 | ||
ENC005730 | ![]() |
0.506 | D0C9XJ | ![]() |
0.258 | ||
ENC005727 | ![]() |
0.494 | D07VLY | ![]() |
0.258 | ||
ENC005729 | ![]() |
0.494 | D03RTK | ![]() |
0.257 | ||
ENC002945 | ![]() |
0.473 | D0FX2Q | ![]() |
0.255 |