|
Name |
2-methyl-actinomycin D
|
| Molecular Formula | C62H88N12O16 | |
| IUPAC Name* |
1-N,9-N-bis[7,14-dimethyl-2,5,9,12,15-pentaoxo-3,10-di(propan-2-yl)-8-oxa-1,4,11,14-tetrazabicyclo[14.3.0]nonadecan-6-yl]-4,6-dimethyl-2-(methylamino)-3-oxophenoxazine-1,9-dicarboxamide
|
|
| SMILES |
CNc1c(C(=O)NC2C(=O)NC(C(C)C)C(=O)N3CCCC3C(=O)N(C)CC(=O)N(C)C(C(C)C)C(O)OC2C)c2nc3c(C(=O)NC4C(=O)NC(C(C)C)C(=O)N5CCCC5C(=O)N(C)CC(=O)NC(C(C)C)C(=O)OC4C)ccc(C)c3oc-2c(C)c1=O
|
|
| InChI |
InChI=1S/C62H88N12O16/c1-27(2)41-59(84)73-23-17-19-36(73)57(82)70(14)25-38(75)64-43(29(5)6)61(86)88-33(11)44(55(80)66-41)68-53(78)35-22-21-31(9)51-46(35)65-48-40(47(63-13)50(77)32(10)52(48)90-51)54(79)69-45-34(12)89-62(87)49(30(7)8)72(16)39(76)26-71(15)58(83)37-20-18-24-74(37)60(85)42(28(3)4)67-56(45)81/h21-22,27-30,33-34,36-37,41-45,49,62-63,87H,17-20,23-26H2,1-16H3,(H,64,75)(H,66,80)(H,67,81)(H,68,78)(H,69,79)
|
|
| InChIKey |
GWQHZZNBEZCYGI-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1257.45 | ALogp: | 0.6 |
| HBD: | 7 | HBA: | 18 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 357.9 | Aromatic Rings: | 7 |
| Heavy Atoms: | 90 | QED Weighted: | 0.116 |
| Caco-2 Permeability: | -5.973 | MDCK Permeability: | 0.00000498 |
| Pgp-inhibitor: | 0.713 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.978 | 20% Bioavailability (F20%): | 0.089 |
| 30% Bioavailability (F30%): | 0.942 |
| Blood-Brain-Barrier Penetration (BBB): | 0.041 | Plasma Protein Binding (PPB): | 97.71% |
| Volume Distribution (VD): | 0.399 | Fu: | 1.30% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.017 |
| CYP2C19-inhibitor: | 0.029 | CYP2C19-substrate: | 0.062 |
| CYP2C9-inhibitor: | 0.097 | CYP2C9-substrate: | 0.089 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.075 |
| CYP3A4-inhibitor: | 0.581 | CYP3A4-substrate: | 0.916 |
| Clearance (CL): | 3.066 | Half-life (T1/2): | 0.291 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.982 |
| Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.823 | Maximum Recommended Daily Dose: | 0.03 |
| Skin Sensitization: | 0.031 | Carcinogencity: | 0.009 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0 |
| Respiratory Toxicity: | 0.012 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003375 | ![]() |
0.781 | D0P8IV | ![]() |
0.781 | ||
| ENC000998 | ![]() |
0.737 | D05MNW | ![]() |
0.332 | ||
| ENC005563 | ![]() |
0.262 | D07XGH | ![]() |
0.332 | ||
| ENC000948 | ![]() |
0.246 | D0J7XL | ![]() |
0.308 | ||
| ENC002129 | ![]() |
0.243 | D0O3YF | ![]() |
0.303 | ||
| ENC002857 | ![]() |
0.241 | D0L9HX | ![]() |
0.301 | ||
| ENC002406 | ![]() |
0.237 | D0E2OU | ![]() |
0.293 | ||
| ENC003271 | ![]() |
0.237 | D06TOE | ![]() |
0.235 | ||
| ENC002483 | ![]() |
0.237 | D0F9BY | ![]() |
0.226 | ||
| ENC003706 | ![]() |
0.235 | D00GNJ | ![]() |
0.224 | ||