|
Name |
29-O-methylabierixin
|
| Molecular Formula | C41H70O11 | |
| IUPAC Name* |
7-hydroxy-8-[2-[5-[5-[6-(hydroxymethyl)-6-methoxy-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-7-methoxy-2,4,6-trimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,4-dimethyloct-2-enoicacid
|
|
| SMILES |
COC1CC(CC(O)CCC(C)C=C(C)C(=O)O)OC2(OC(C)(C3CCC(C)(C4OC(C5OC(CO)(OC)C(C)CC5C)CC4C)O3)CC2C)C1C
|
|
| InChI |
InChI=1S/C41H70O11/c1-23(16-26(4)37(44)45)12-13-30(43)19-31-20-32(46-10)29(7)41(49-31)28(6)21-39(9,52-41)34-14-15-38(8,50-34)36-25(3)18-33(48-36)35-24(2)17-27(5)40(22-42,47-11)51-35/h16,23-25,27-36,42-43H,12-15,17-22H2,1-11H3,(H,44,45)/b26-16+/t23-,24+,25+,27-,28-,29-,30+,31-,32-,33-,34-,35+,36-,38+,39+,40+,41-/m1/s1
|
|
| InChIKey |
GNPMBZFLZWGKOC-IPVIHWSRSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 739.0 | ALogp: | 6.3 |
| HBD: | 3 | HBA: | 10 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 142.4 | Aromatic Rings: | 5 |
| Heavy Atoms: | 52 | QED Weighted: | 0.184 |
| Caco-2 Permeability: | -5.102 | MDCK Permeability: | 0.00001580 |
| Pgp-inhibitor: | 0.983 | Pgp-substrate: | 0.023 |
| Human Intestinal Absorption (HIA): | 0.049 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.206 |
| Blood-Brain-Barrier Penetration (BBB): | 0.023 | Plasma Protein Binding (PPB): | 97.32% |
| Volume Distribution (VD): | 0.79 | Fu: | 2.21% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.425 |
| CYP2C19-inhibitor: | 0.002 | CYP2C19-substrate: | 0.957 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.018 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.135 |
| CYP3A4-inhibitor: | 0.085 | CYP3A4-substrate: | 0.799 |
| Clearance (CL): | 19.559 | Half-life (T1/2): | 0.057 |
| hERG Blockers: | 0.39 | Human Hepatotoxicity (H-HT): | 0.852 |
| Drug-inuced Liver Injury (DILI): | 0.389 | AMES Toxicity: | 0.035 |
| Rat Oral Acute Toxicity: | 0.99 | Maximum Recommended Daily Dose: | 0.255 |
| Skin Sensitization: | 0.073 | Carcinogencity: | 0.232 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.949 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003808 | ![]() |
0.885 | D09YHJ | ![]() |
0.252 | ||
| ENC004466 | ![]() |
0.238 | D06ZUP | ![]() |
0.238 | ||
| ENC003276 | ![]() |
0.237 | D0X1WJ | ![]() |
0.238 | ||
| ENC002246 | ![]() |
0.231 | D0E4SI | ![]() |
0.228 | ||
| ENC002795 | ![]() |
0.228 | D04JMQ | ![]() |
0.227 | ||
| ENC003938 | ![]() |
0.227 | D0Z1ZM | ![]() |
0.226 | ||
| ENC001918 | ![]() |
0.225 | D03HJK | ![]() |
0.226 | ||
| ENC001478 | ![]() |
0.224 | D0X7XG | ![]() |
0.224 | ||
| ENC000865 | ![]() |
0.222 | D0J7OG | ![]() |
0.224 | ||
| ENC002021 | ![]() |
0.222 | D02YIZ | ![]() |
0.223 | ||