|
Name |
Abierixin
|
| Molecular Formula | C40H68O11 | |
| IUPAC Name* |
(Z,4S,7S)-7-hydroxy-8-[(2R,4S,5R,6S,7R,9S)-2-[(2S,5S)-5-[(2S,3S,5R)-5-[(2S,3R,5S,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-7-methoxy-2,4,6-trimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,4-dimethyloct-2-enoic acid
|
|
| SMILES |
C[C@@H]1C[C@@H]([C@@](O[C@@H]1[C@H]2C[C@@H]([C@H](O2)[C@@]3(CC[C@H](O3)[C@]4(C[C@@H]([C@@]5(O4)[C@H]([C@@H](C[C@@H](O5)C[C@H](CC[C@H](C)/C=C(/C)\C(=O)O)O)OC)C)C)C)C)C)(CO)O)C
|
|
| InChI |
InChI=1S/C40H68O11/c1-22(15-25(4)36(43)44)11-12-29(42)18-30-19-31(46-10)28(7)40(48-30)27(6)20-38(9,51-40)33-13-14-37(8,49-33)35-24(3)17-32(47-35)34-23(2)16-26(5)39(45,21-41)50-34/h15,22-24,26-35,41-42,45H,11-14,16-21H2,1-10H3,(H,43,44)/b25-15-/t22-,23+,24-,26-,27-,28-,29-,30-,31+,32+,33-,34-,35-,37-,38+,39-,40+/m0/s1
|
|
| InChIKey |
JQESXHYTUWEFCM-YIXJCDIJSA-N
|
|
| Synonyms |
Abierixin
|
|
| CAS | NA | |
| PubChem CID | 139589019 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 725.0 | ALogp: | 5.3 |
| HBD: | 4 | HBA: | 11 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 153.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 51 | QED Weighted: | 0.181 |
| Caco-2 Permeability: | -5.131 | MDCK Permeability: | 0.00004500 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.903 |
| Human Intestinal Absorption (HIA): | 0.023 | 20% Bioavailability (F20%): | 0.014 |
| 30% Bioavailability (F30%): | 0.135 |
| Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 92.30% |
| Volume Distribution (VD): | 0.68 | Fu: | 7.35% |
| CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.457 |
| CYP2C19-inhibitor: | 0.003 | CYP2C19-substrate: | 0.713 |
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.004 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.147 | CYP3A4-substrate: | 0.292 |
| Clearance (CL): | 7.614 | Half-life (T1/2): | 0.34 |
| hERG Blockers: | 0.294 | Human Hepatotoxicity (H-HT): | 0.98 |
| Drug-inuced Liver Injury (DILI): | 0.949 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.065 | Maximum Recommended Daily Dose: | 0.472 |
| Skin Sensitization: | 0.912 | Carcinogencity: | 0.566 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
| Respiratory Toxicity: | 0.947 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005229 | ![]() |
0.885 | D09YHJ | ![]() |
0.250 | ||
| ENC002246 | ![]() |
0.240 | D0X1WJ | ![]() |
0.235 | ||
| ENC002795 | ![]() |
0.238 | D06ZUP | ![]() |
0.231 | ||
| ENC003938 | ![]() |
0.238 | D0X7XG | ![]() |
0.228 | ||
| ENC001918 | ![]() |
0.234 | D0J7OG | ![]() |
0.227 | ||
| ENC005283 | ![]() |
0.231 | D0E4SI | ![]() |
0.226 | ||
| ENC004466 | ![]() |
0.231 | D04JMQ | ![]() |
0.224 | ||
| ENC000865 | ![]() |
0.231 | D03HJK | ![]() |
0.223 | ||
| ENC003276 | ![]() |
0.229 | D0F5OR | ![]() |
0.221 | ||
| ENC001478 | ![]() |
0.228 | D02YIZ | ![]() |
0.221 | ||