|
Name |
Anicequol
|
| Molecular Formula | C30H48O6 | |
| IUPAC Name* |
[(3S,5S,7R,8S,9S,10R,11S,13S,14S,16S,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3,7,11-trihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate
|
|
| SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1[C@H](C[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2[C@H](C(=O)[C@@H]4[C@@]3(CC[C@@H](C4)O)C)O)O)C)OC(=O)C
|
|
| InChI |
InChI=1S/C30H48O6/c1-15(2)16(3)8-9-17(4)25-23(36-18(5)31)13-20-24-26(22(33)14-30(20,25)7)29(6)11-10-19(32)12-21(29)27(34)28(24)35/h8-9,15-17,19-26,28,32-33,35H,10-14H2,1-7H3/b9-8+/t16-,17+,19-,20-,21+,22-,23-,24-,25-,26-,28+,29-,30-/m0/s1
|
|
| InChIKey |
LWMKDRSIMLTGDK-TZEVRYHJSA-N
|
|
| Synonyms |
ANICEQUOL; CHEMBL1770668; DTXSID201045471; Q15410277; [(3S,5S,7R,8S,9S,10R,11S,13S,14S,16S,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3,7,11-trihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate; 163565-48-8
|
|
| CAS | 163565-48-8 | |
| PubChem CID | 10413810 | |
| ChEMBL ID | CHEMBL1770668 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 504.7 | ALogp: | 4.5 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 104.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.369 |
| Caco-2 Permeability: | -4.904 | MDCK Permeability: | 0.00008080 |
| Pgp-inhibitor: | 0.935 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.42 | 20% Bioavailability (F20%): | 0.028 |
| 30% Bioavailability (F30%): | 0.869 |
| Blood-Brain-Barrier Penetration (BBB): | 0.592 | Plasma Protein Binding (PPB): | 82.79% |
| Volume Distribution (VD): | 0.806 | Fu: | 5.02% |
| CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.124 |
| CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.866 |
| CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.034 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.049 |
| CYP3A4-inhibitor: | 0.38 | CYP3A4-substrate: | 0.669 |
| Clearance (CL): | 4.753 | Half-life (T1/2): | 0.469 |
| hERG Blockers: | 0.202 | Human Hepatotoxicity (H-HT): | 0.325 |
| Drug-inuced Liver Injury (DILI): | 0.535 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.886 | Maximum Recommended Daily Dose: | 0.9 |
| Skin Sensitization: | 0.141 | Carcinogencity: | 0.053 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.973 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002795 | ![]() |
0.778 | D0G5CF | ![]() |
0.338 | ||
| ENC003779 | ![]() |
0.649 | D0OR2L | ![]() |
0.336 | ||
| ENC005209 | ![]() |
0.429 | D0X7XG | ![]() |
0.327 | ||
| ENC004735 | ![]() |
0.408 | D0G8OC | ![]() |
0.323 | ||
| ENC004757 | ![]() |
0.406 | D0G3SH | ![]() |
0.321 | ||
| ENC004804 | ![]() |
0.406 | D03ZTE | ![]() |
0.321 | ||
| ENC005438 | ![]() |
0.406 | D0M4WA | ![]() |
0.309 | ||
| ENC001984 | ![]() |
0.406 | D06JPB | ![]() |
0.304 | ||
| ENC003554 | ![]() |
0.393 | D04SFH | ![]() |
0.302 | ||
| ENC002206 | ![]() |
0.392 | D0N1TP | ![]() |
0.271 | ||