|
Name |
Dirithromycin
|
| Molecular Formula | C42H78N2O14 | |
| IUPAC Name* |
(1R,2R,3R,6R,7S,8S,9R,10R,12R,13S,15R,17S)-9-[(2S,3R,4S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-ethyl-2,10-dihydroxy-7-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-15-(2-methoxyethoxymethyl)-2,6,8,10,12,17-hexamethyl-4,16-dioxa-14-azabicyclo[11.3.1]heptadecan-5-one
|
|
| SMILES |
CC[C@@H]1[C@@]([C@H]2[C@H]([C@H]([C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]3C[C@@]([C@H]([C@@H](O3)C)O)(C)OC)C)O[C@H]4[C@@H]([C@H](CC(O4)C)N(C)C)O)(C)O)C)N[C@H](O2)COCCOC)C)(C)O
|
|
| InChI |
InChI=1S/C42H78N2O14/c1-15-29-42(10,49)37-24(4)32(43-30(56-37)21-52-17-16-50-13)22(2)19-40(8,48)36(58-39-33(45)28(44(11)12)18-23(3)53-39)25(5)34(26(6)38(47)55-29)57-31-20-41(9,51-14)35(46)27(7)54-31/h22-37,39,43,45-46,48-49H,15-21H2,1-14H3/t22-,23?,24+,25+,26-,27+,28+,29-,30-,31+,32+,33-,34+,35+,36-,37-,39+,40-,41-,42-/m1/s1
|
|
| InChIKey |
WLOHNSSYAXHWNR-BCPOCVISSA-N
|
|
| Synonyms |
Dirithromycin; D5495
|
|
| CAS | 62013-04-1 | |
| PubChem CID | 164186513 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 835.1 | ALogp: | 4.2 |
| HBD: | 5 | HBA: | 16 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 196.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 58 | QED Weighted: | 0.142 |
| Caco-2 Permeability: | -5.536 | MDCK Permeability: | 0.00012092 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0.731 |
| Human Intestinal Absorption (HIA): | 0.102 | 20% Bioavailability (F20%): | 0.996 |
| 30% Bioavailability (F30%): | 0.974 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 44.82% |
| Volume Distribution (VD): | 0.457 | Fu: | 33.86% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.196 |
| CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.91 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.004 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.092 |
| CYP3A4-inhibitor: | 0.194 | CYP3A4-substrate: | 0.893 |
| Clearance (CL): | 3.772 | Half-life (T1/2): | 0.612 |
| hERG Blockers: | 0.831 | Human Hepatotoxicity (H-HT): | 0.669 |
| Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.323 |
| Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.006 |
| Skin Sensitization: | 0.092 | Carcinogencity: | 0.05 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.835 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004292 | ![]() |
0.280 | D06ZUP | ![]() |
1.000 | ||
| ENC003639 | ![]() |
0.279 | D02YIZ | ![]() |
0.694 | ||
| ENC004223 | ![]() |
0.272 | D03HJK | ![]() |
0.692 | ||
| ENC003727 | ![]() |
0.272 | D0Z1ZM | ![]() |
0.672 | ||
| ENC003730 | ![]() |
0.270 | D04JMQ | ![]() |
0.648 | ||
| ENC003877 | ![]() |
0.269 | D0E4SI | ![]() |
0.605 | ||
| ENC003236 | ![]() |
0.269 | D0TG7I | ![]() |
0.553 | ||
| ENC003127 | ![]() |
0.267 | D0Q6OS | ![]() |
0.386 | ||
| ENC003621 | ![]() |
0.263 | D06IGU | ![]() |
0.385 | ||
| ENC004293 | ![]() |
0.261 | D0F5OR | ![]() |
0.376 | ||