|
Name |
3β,15β-dihydroxyl-(22E, 24R)-ergosta-5,8(14),22-trien-7-dione
|
| Molecular Formula | C28H42O3 | |
| IUPAC Name* |
17-(5,6-dimethylhept-3-en-2-yl)-3,15-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-7-one
|
|
| SMILES |
CC(C)C(C)C=CC(C)C1CC(O)C2=C3C(=O)C=C4CC(O)CCC4(C)C3CCC21C
|
|
| InChI |
InChI=1S/C28H42O3/c1-16(2)17(3)7-8-18(4)22-15-24(31)26-25-21(10-12-28(22,26)6)27(5)11-9-20(29)13-19(27)14-23(25)30/h7-8,14,16-18,20-22,24,29,31H,9-13,15H2,1-6H3/b8-7+/t17-,18+,20-,21?,22?,24+,27-,28+/m0/s1
|
|
| InChIKey |
KFZWTDMJABGTQG-FBSMMNJASA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 426.64 | ALogp: | 5.6 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 57.5 | Aromatic Rings: | 4 |
| Heavy Atoms: | 31 | QED Weighted: | 0.56 |
| Caco-2 Permeability: | -4.826 | MDCK Permeability: | 0.00001420 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.339 |
| 30% Bioavailability (F30%): | 0.678 |
| Blood-Brain-Barrier Penetration (BBB): | 0.952 | Plasma Protein Binding (PPB): | 96.40% |
| Volume Distribution (VD): | 1.318 | Fu: | 2.70% |
| CYP1A2-inhibitor: | 0.031 | CYP1A2-substrate: | 0.639 |
| CYP2C19-inhibitor: | 0.187 | CYP2C19-substrate: | 0.951 |
| CYP2C9-inhibitor: | 0.236 | CYP2C9-substrate: | 0.116 |
| CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.237 |
| CYP3A4-inhibitor: | 0.75 | CYP3A4-substrate: | 0.829 |
| Clearance (CL): | 20.777 | Half-life (T1/2): | 0.057 |
| hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.31 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.227 | Maximum Recommended Daily Dose: | 0.814 |
| Skin Sensitization: | 0.887 | Carcinogencity: | 0.07 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.859 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006033 | ![]() |
0.627 | D0G5CF | ![]() |
0.456 | ||
| ENC001092 | ![]() |
0.577 | D0G8OC | ![]() |
0.426 | ||
| ENC005707 | ![]() |
0.577 | D06JPB | ![]() |
0.414 | ||
| ENC004738 | ![]() |
0.577 | D0Y7LD | ![]() |
0.358 | ||
| ENC001558 | ![]() |
0.519 | D0K0EK | ![]() |
0.349 | ||
| ENC004758 | ![]() |
0.519 | D0N1TP | ![]() |
0.339 | ||
| ENC004022 | ![]() |
0.505 | D08SVH | ![]() |
0.328 | ||
| ENC004737 | ![]() |
0.505 | D01QUS | ![]() |
0.315 | ||
| ENC004736 | ![]() |
0.505 | D0G8BV | ![]() |
0.298 | ||
| ENC002665 | ![]() |
0.505 | D0B4RU | ![]() |
0.298 | ||