|
Name |
(22E,24R)-ergosta-5,22-dien-3β-ol
|
| Molecular Formula | C28H46O | |
| IUPAC Name* |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
|
|
| SMILES |
CC(C)C(C)C=CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C
|
|
| InChI |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23?,24+,25?,26?,27-,28+/m0/s1
|
|
| InChIKey |
OILXMJHPFNGGTO-SMEBRQAXSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 398.68 | ALogp: | 7.4 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.485 |
| Caco-2 Permeability: | -4.657 | MDCK Permeability: | 0.00000880 |
| Pgp-inhibitor: | 0.107 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.183 |
| Blood-Brain-Barrier Penetration (BBB): | 0.667 | Plasma Protein Binding (PPB): | 98.71% |
| Volume Distribution (VD): | 2.175 | Fu: | 1.84% |
| CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.594 |
| CYP2C19-inhibitor: | 0.063 | CYP2C19-substrate: | 0.957 |
| CYP2C9-inhibitor: | 0.109 | CYP2C9-substrate: | 0.13 |
| CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.56 |
| CYP3A4-inhibitor: | 0.32 | CYP3A4-substrate: | 0.849 |
| Clearance (CL): | 17.367 | Half-life (T1/2): | 0.015 |
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.01 |
| Drug-inuced Liver Injury (DILI): | 0.068 | AMES Toxicity: | 0.033 |
| Rat Oral Acute Toxicity: | 0.069 | Maximum Recommended Daily Dose: | 0.287 |
| Skin Sensitization: | 0.027 | Carcinogencity: | 0.064 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.148 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001558 | ![]() |
1.000 | D0Y7LD | ![]() |
0.698 | ||
| ENC001545 | ![]() |
0.852 | D0B4RU | ![]() |
0.600 | ||
| ENC005068 | ![]() |
0.742 | D0K0EK | ![]() |
0.511 | ||
| ENC000961 | ![]() |
0.739 | D0G8OC | ![]() |
0.509 | ||
| ENC001107 | ![]() |
0.698 | D06JPB | ![]() |
0.468 | ||
| ENC001008 | ![]() |
0.698 | D0G5CF | ![]() |
0.434 | ||
| ENC000125 | ![]() |
0.681 | D02STN | ![]() |
0.409 | ||
| ENC003369 | ![]() |
0.676 | D06XMU | ![]() |
0.404 | ||
| ENC001846 | ![]() |
0.676 | D07BSQ | ![]() |
0.371 | ||
| ENC004738 | ![]() |
0.649 | D04DJN | ![]() |
0.363 | ||