|
Name |
ergosta-4,6,8(14),22-tetraene-3β-ol
|
| Molecular Formula | C28H42O | |
| IUPAC Name* |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,9,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-ol
|
|
| SMILES |
CC(C)C(C)C=CC(C)C1CCC2=C3C=CC4=CC(O)CCC4(C)C3CCC21C
|
|
| InChI |
InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,17-20,22,24,26,29H,11-16H2,1-6H3/b8-7+/t19-,20+,22-,24?,26?,27-,28+/m0/s1
|
|
| InChIKey |
SHHHPKBCWIDXJY-SAHIRSJGSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 394.64 | ALogp: | 7.3 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.498 |
| Caco-2 Permeability: | -4.803 | MDCK Permeability: | 0.00001130 |
| Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.015 |
| 30% Bioavailability (F30%): | 0.227 |
| Blood-Brain-Barrier Penetration (BBB): | 0.062 | Plasma Protein Binding (PPB): | 100.14% |
| Volume Distribution (VD): | 2.431 | Fu: | 1.78% |
| CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.636 |
| CYP2C19-inhibitor: | 0.129 | CYP2C19-substrate: | 0.969 |
| CYP2C9-inhibitor: | 0.209 | CYP2C9-substrate: | 0.175 |
| CYP2D6-inhibitor: | 0.311 | CYP2D6-substrate: | 0.447 |
| CYP3A4-inhibitor: | 0.872 | CYP3A4-substrate: | 0.919 |
| Clearance (CL): | 14.728 | Half-life (T1/2): | 0.032 |
| hERG Blockers: | 0.473 | Human Hepatotoxicity (H-HT): | 0.032 |
| Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.148 | Maximum Recommended Daily Dose: | 0.761 |
| Skin Sensitization: | 0.672 | Carcinogencity: | 0.147 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.961 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004737 | ![]() |
0.758 | D06JPB | ![]() |
0.416 | ||
| ENC001861 | ![]() |
0.758 | D0G8OC | ![]() |
0.416 | ||
| ENC004022 | ![]() |
0.758 | D0G5CF | ![]() |
0.397 | ||
| ENC003368 | ![]() |
0.646 | D0Y7LD | ![]() |
0.304 | ||
| ENC003739 | ![]() |
0.620 | D0N1TP | ![]() |
0.296 | ||
| ENC003880 | ![]() |
0.604 | D08SVH | ![]() |
0.276 | ||
| ENC003667 | ![]() |
0.584 | D0K0EK | ![]() |
0.275 | ||
| ENC004834 | ![]() |
0.573 | D0K5WS | ![]() |
0.274 | ||
| ENC004998 | ![]() |
0.571 | D01QUS | ![]() |
0.273 | ||
| ENC002984 | ![]() |
0.558 | D0F1UL | ![]() |
0.263 | ||