|
Name |
(22E)-Ergosta-4,7,22-trien-3-one
|
| Molecular Formula | C28H42O | |
| IUPAC Name* |
17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one
|
|
| SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)C1CCC2C1(CCC3C2=CCC4=CC(=O)CCC34C)C
|
|
| InChI |
InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-8,10,17-20,24-26H,9,11-16H2,1-6H3/b8-7+/t19-,20+,24?,25?,26?,27?,28?/m0/s1
|
|
| InChIKey |
JBSSIYVUAQDIMG-ZMLAXQGISA-N
|
|
| Synonyms |
(22E)-Ergosta-4,7,22-trien-3-one; (22E)-9-BETA-ERGOSTA-4,7,22-TRIEN-3-ONE
|
|
| CAS | NA | |
| PubChem CID | 45044502 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 394.6 | ALogp: | 7.1 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 17.1 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.444 |
| Caco-2 Permeability: | -4.924 | MDCK Permeability: | 0.00000781 |
| Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.353 |
| 30% Bioavailability (F30%): | 0.431 |
| Blood-Brain-Barrier Penetration (BBB): | 0.891 | Plasma Protein Binding (PPB): | 95.67% |
| Volume Distribution (VD): | 1.532 | Fu: | 1.47% |
| CYP1A2-inhibitor: | 0.058 | CYP1A2-substrate: | 0.481 |
| CYP2C19-inhibitor: | 0.075 | CYP2C19-substrate: | 0.971 |
| CYP2C9-inhibitor: | 0.158 | CYP2C9-substrate: | 0.135 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.307 |
| CYP3A4-inhibitor: | 0.313 | CYP3A4-substrate: | 0.926 |
| Clearance (CL): | 1.451 | Half-life (T1/2): | 0.105 |
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.195 |
| Drug-inuced Liver Injury (DILI): | 0.234 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.973 | Maximum Recommended Daily Dose: | 0.78 |
| Skin Sensitization: | 0.54 | Carcinogencity: | 0.033 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.027 |
| Respiratory Toxicity: | 0.972 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003120 | ![]() |
0.737 | D06JPB | ![]() |
0.468 | ||
| ENC004906 | ![]() |
0.737 | D0G8OC | ![]() |
0.468 | ||
| ENC005258 | ![]() |
0.667 | D0G5CF | ![]() |
0.446 | ||
| ENC004738 | ![]() |
0.667 | D06XMU | ![]() |
0.363 | ||
| ENC005707 | ![]() |
0.667 | D07BSQ | ![]() |
0.358 | ||
| ENC001092 | ![]() |
0.667 | D0G8BV | ![]() |
0.346 | ||
| ENC004735 | ![]() |
0.600 | D0Z1XD | ![]() |
0.343 | ||
| ENC002892 | ![]() |
0.594 | D0N1TP | ![]() |
0.339 | ||
| ENC006033 | ![]() |
0.588 | D0Y7LD | ![]() |
0.336 | ||
| ENC004737 | ![]() |
0.569 | D0F1UL | ![]() |
0.333 | ||