|
Name |
gliocladicillin C
|
| Molecular Formula | C32H32N6O7S4 | |
| IUPAC Name* |
14-ethyl-2-hydroxy-3-[2-hydroxy-14-(1-hydroxyethyl)-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
| SMILES |
CCC12SSC3(C(=O)N1C)C(O)C1(C45c6ccccc6NC4N4C(=O)C6(C(C)O)SSC4(C(=O)N6C)C5O)c4ccccc4NC1N3C2=O
|
|
| InChI |
InChI=1S/C32H32N6O7S4/c1-5-27-23(42)37-21-28(15-10-6-8-12-17(15)33-21,19(40)31(37,48-46-27)24(43)35(27)3)29-16-11-7-9-13-18(16)34-22(29)38-26(45)30(14(2)39)36(4)25(44)32(38,20(29)41)49-47-30/h6-14,19-22,33-34,39-41H,5H2,1-4H3/t14?,19-,20-,21+,22+,27+,28+,29+,30-,31-,32-/m0/s1
|
|
| InChIKey |
SVPXFXKBMKASSB-UVAWYAHKSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 740.91 | ALogp: | 1.1 |
| HBD: | 5 | HBA: | 13 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 166.0 | Aromatic Rings: | 12 |
| Heavy Atoms: | 49 | QED Weighted: | 0.288 |
| Caco-2 Permeability: | -5.476 | MDCK Permeability: | 0.00001690 |
| Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.133 |
| Human Intestinal Absorption (HIA): | 0.956 | 20% Bioavailability (F20%): | 0.986 |
| 30% Bioavailability (F30%): | 0.988 |
| Blood-Brain-Barrier Penetration (BBB): | 0.132 | Plasma Protein Binding (PPB): | 73.62% |
| Volume Distribution (VD): | 0.794 | Fu: | 24.39% |
| CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.137 |
| CYP2C19-inhibitor: | 0.951 | CYP2C19-substrate: | 0.962 |
| CYP2C9-inhibitor: | 0.979 | CYP2C9-substrate: | 0.383 |
| CYP2D6-inhibitor: | 0.109 | CYP2D6-substrate: | 0.067 |
| CYP3A4-inhibitor: | 0.961 | CYP3A4-substrate: | 0.989 |
| Clearance (CL): | 4.733 | Half-life (T1/2): | 0.001 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.076 |
| Drug-inuced Liver Injury (DILI): | 0.959 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.999 | Maximum Recommended Daily Dose: | 0.597 |
| Skin Sensitization: | 0.303 | Carcinogencity: | 0.421 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.003 |
| Respiratory Toxicity: | 0.083 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003381 | ![]() |
0.894 | D09NNH | ![]() |
0.234 | ||
| ENC003382 | ![]() |
0.880 | D0SP3D | ![]() |
0.228 | ||
| ENC003490 | ![]() |
0.864 | D01TSI | ![]() |
0.227 | ||
| ENC003176 | ![]() |
0.784 | D0V3ZA | ![]() |
0.222 | ||
| ENC003588 | ![]() |
0.742 | D04RLY | ![]() |
0.218 | ||
| ENC004848 | ![]() |
0.596 | D0E0RY | ![]() |
0.215 | ||
| ENC002358 | ![]() |
0.516 | D0J5YC | ![]() |
0.212 | ||
| ENC001500 | ![]() |
0.512 | D0K4CQ | ![]() |
0.211 | ||
| ENC003992 | ![]() |
0.503 | D0V9WF | ![]() |
0.209 | ||
| ENC003455 | ![]() |
0.441 | D08UMH | ![]() |
0.209 | ||