![]() |
Name |
(+)-Verticillin D
|
Molecular Formula | C32H32N6O8S4 | |
IUPAC Name* |
(1S,2S,3S,11R,14S)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-3-[(1S,2S,3S,11R,14S)-2-hydroxy-14-[(1R)-1-hydroxyethyl]-18-methyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
SMILES |
C[C@H]([C@]12C(=O)N3[C@@H]4[C@]([C@@H]([C@@]3(C(=O)N1C)SS2)O)(C5=CC=CC=C5N4)[C@]67[C@@H]([C@]89C(=O)N([C@](C(=O)N8[C@H]6NC1=CC=CC=C71)(SS9)[C@@H](C)O)C)O)O
|
|
InChI |
InChI=1S/C32H32N6O8S4/c1-13(39)29-25(45)37-21-27(15-9-5-7-11-17(15)33-21,19(41)31(37,49-47-29)23(43)35(29)3)28-16-10-6-8-12-18(16)34-22(28)38-26(46)30(14(2)40)36(4)24(44)32(38,20(28)42)50-48-30/h5-14,19-22,33-34,39-42H,1-4H3/t13-,14-,19+,20+,21-,22-,27-,28-,29+,30+,31+,32+/m1/s1
|
|
InChIKey |
SYHNGIDZSPMVHV-PYABMYGPSA-N
|
|
Synonyms |
(+)-Verticillin D; Verticillin D, (+)-; Verticillin D; 7UN3QA3442; (10b,10'b(11H,11'H)-Bi-3,11a-epidithio-11ah-pyrazino(1',2':1,5)pyrrolo(2,3-b)indole)-1,1',4,4'-tetrone, 2,2',3,3',5a,5'a,6,6'-octahydro-11,11'-dihydroxy-3,3'-bis(1-hydroxyethyl)-2,2'-dimethyl-, (3S,3'S,5aR,5'ar,10bS,10'bs,11S,11'S,11aS,11'as)-; (3S,3'S,5aR,5'Ar,10bS,10'bs,11S,11'S,11aS,11'as)-2,2',3,3',5a,5'a,6,6'-octahydro-11,11'-dihydroxy-3,3'-bis(1-hydroxyethyl)-2,2'-dimethyl(10b,10'b(11H,11'H)-bi-3,11a-epidithio-11ah-pyrazino(1',2':1,5)pyrrolo(2,3-b)indole)-1,1',4,4'-tetrone; 226905-58-4; Verticillin D_130016; UNII-7UN3QA3442
|
|
CAS | 226905-58-4 | |
PubChem CID | 134768544 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 756.9 | ALogp: | 0.9 |
HBD: | 6 | HBA: | 14 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 287.0 | Aromatic Rings: | 12 |
Heavy Atoms: | 50 | QED Weighted: | 0.237 |
Caco-2 Permeability: | -6.185 | MDCK Permeability: | 0.00000643 |
Pgp-inhibitor: | 0.209 | Pgp-substrate: | 0.95 |
Human Intestinal Absorption (HIA): | 0.406 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.167 | Plasma Protein Binding (PPB): | 77.00% |
Volume Distribution (VD): | 1.269 | Fu: | 9.83% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.086 |
CYP2C19-inhibitor: | 0.937 | CYP2C19-substrate: | 0.925 |
CYP2C9-inhibitor: | 0.974 | CYP2C9-substrate: | 0.308 |
CYP2D6-inhibitor: | 0.046 | CYP2D6-substrate: | 0.075 |
CYP3A4-inhibitor: | 0.933 | CYP3A4-substrate: | 0.985 |
Clearance (CL): | 5.04 | Half-life (T1/2): | 0.023 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.102 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.861 | Maximum Recommended Daily Dose: | 0.229 |
Skin Sensitization: | 0.906 | Carcinogencity: | 0.405 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.144 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003381 | ![]() |
0.882 | D09NNH | ![]() |
0.231 | ||
ENC004849 | ![]() |
0.864 | D0SP3D | ![]() |
0.221 | ||
ENC003176 | ![]() |
0.773 | D01TSI | ![]() |
0.220 | ||
ENC003382 | ![]() |
0.758 | D0V3ZA | ![]() |
0.214 | ||
ENC003588 | ![]() |
0.732 | D0O5WP | ![]() |
0.209 | ||
ENC004848 | ![]() |
0.589 | D0K4CQ | ![]() |
0.208 | ||
ENC002358 | ![]() |
0.510 | D0W7RJ | ![]() |
0.206 | ||
ENC001500 | ![]() |
0.506 | D0E0RY | ![]() |
0.205 | ||
ENC003992 | ![]() |
0.415 | D0D4YZ | ![]() |
0.204 | ||
ENC003455 | ![]() |
0.399 | D02XIY | ![]() |
0.204 |