|
Name |
Chetomin
|
| Molecular Formula | C31H30N6O6S4 | |
| IUPAC Name* |
(1R,3R,11S,14R)-14-(hydroxymethyl)-3-[3-[[(1R,4R)-4-(hydroxymethyl)-5,7-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]methyl]indol-1-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
| SMILES |
CN1C(=O)[C@@]2(N(C(=O)[C@]1(SS2)CC3=CN(C4=CC=CC=C43)[C@@]56C[C@@]78C(=O)N([C@@](C(=O)N7[C@@H]5NC9=CC=CC=C69)(SS8)CO)C)C)CO
|
|
| InChI |
InChI=1S/C31H30N6O6S4/c1-33-25(42)30(15-38)34(2)23(40)28(33,44-46-30)12-17-13-36(21-11-7-4-8-18(17)21)27-14-29-24(41)35(3)31(16-39,47-45-29)26(43)37(29)22(27)32-20-10-6-5-9-19(20)27/h4-11,13,22,32,38-39H,12,14-16H2,1-3H3/t22-,27+,28+,29+,30+,31+/m0/s1
|
|
| InChIKey |
ZRZWBWPDBOVIGQ-KHMLTABWSA-N
|
|
| Synonyms |
Chetomin; 1403-36-7
|
|
| CAS | 1403-36-7 | |
| PubChem CID | 133126865 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 710.9 | ALogp: | 1.9 |
| HBD: | 3 | HBA: | 11 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 240.0 | Aromatic Rings: | 11 |
| Heavy Atoms: | 47 | QED Weighted: | 0.337 |
| Caco-2 Permeability: | -5.451 | MDCK Permeability: | 0.00002280 |
| Pgp-inhibitor: | 0.96 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.937 | 20% Bioavailability (F20%): | 0.979 |
| 30% Bioavailability (F30%): | 0.991 |
| Blood-Brain-Barrier Penetration (BBB): | 0.065 | Plasma Protein Binding (PPB): | 89.65% |
| Volume Distribution (VD): | 0.826 | Fu: | 4.29% |
| CYP1A2-inhibitor: | 0.031 | CYP1A2-substrate: | 0.206 |
| CYP2C19-inhibitor: | 0.973 | CYP2C19-substrate: | 0.971 |
| CYP2C9-inhibitor: | 0.983 | CYP2C9-substrate: | 0.223 |
| CYP2D6-inhibitor: | 0.077 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.975 | CYP3A4-substrate: | 0.992 |
| Clearance (CL): | 8.788 | Half-life (T1/2): | 0.305 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.264 |
| Drug-inuced Liver Injury (DILI): | 0.996 | AMES Toxicity: | 0.043 |
| Rat Oral Acute Toxicity: | 0.934 | Maximum Recommended Daily Dose: | 0.366 |
| Skin Sensitization: | 0.883 | Carcinogencity: | 0.838 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.001 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003978 | ![]() |
0.807 | D0V9WF | ![]() |
0.268 | ||
| ENC002642 | ![]() |
0.763 | D02TJS | ![]() |
0.230 | ||
| ENC002348 | ![]() |
0.581 | D0SP3D | ![]() |
0.227 | ||
| ENC004867 | ![]() |
0.581 | D01TSI | ![]() |
0.226 | ||
| ENC001500 | ![]() |
0.471 | D0J5YC | ![]() |
0.224 | ||
| ENC004848 | ![]() |
0.466 | D07VHR | ![]() |
0.222 | ||
| ENC003382 | ![]() |
0.453 | D09NNH | ![]() |
0.221 | ||
| ENC004849 | ![]() |
0.441 | D0V3ZA | ![]() |
0.220 | ||
| ENC003530 | ![]() |
0.435 | D07NVU | ![]() |
0.219 | ||
| ENC003176 | ![]() |
0.421 | D0E3OF | ![]() |
0.216 | ||