|
Name |
Gliocladine B
|
| Molecular Formula | C30H28N6O6S6 | |
| IUPAC Name* |
(1S,2S,3S,11R,14S)-2-hydroxy-3-[(1S,2S,11R,14S)-2-hydroxy-14,18-dimethyl-13,17-dioxo-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-trien-3-yl]-14,20-dimethyl-15,16,17,18-tetrathia-10,12,20-triazapentacyclo[12.4.2.01,12.03,11.04,9]icosa-4,6,8-triene-13,19-dione
|
|
| SMILES |
C[C@]12C(=O)N3[C@@H]4[C@]([C@@H]([C@@]3(C(=O)N1C)SSSS2)O)(C5=CC=CC=C5N4)C67[C@@H]([C@]89C(=O)N([C@](C(=O)N8[C@H]6NC1=CC=CC=C71)(SS9)C)C)O
|
|
| InChI |
InChI=1S/C30H28N6O6S6/c1-25-21(39)35-19-27(13-9-5-7-11-15(13)31-19,17(37)29(35,45-43-25)23(41)33(25)3)28-14-10-6-8-12-16(14)32-20(28)36-22(40)26(2)34(4)24(42)30(36,18(28)38)46-48-47-44-26/h5-12,17-20,31-32,37-38H,1-4H3/t17-,18-,19+,20+,25-,26-,27?,28+,29-,30-/m0/s1
|
|
| InChIKey |
IRLKNNGUSBXLNJ-DVVXIOMLSA-N
|
|
| Synonyms |
gliocladine B
|
|
| CAS | NA | |
| PubChem CID | 139583525 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 761.0 | ALogp: | 1.9 |
| HBD: | 4 | HBA: | 14 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 298.0 | Aromatic Rings: | 12 |
| Heavy Atoms: | 48 | QED Weighted: | 0.315 |
| Caco-2 Permeability: | -6.077 | MDCK Permeability: | 0.00001290 |
| Pgp-inhibitor: | 0.881 | Pgp-substrate: | 0.565 |
| Human Intestinal Absorption (HIA): | 0.79 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.367 | Plasma Protein Binding (PPB): | 70.20% |
| Volume Distribution (VD): | 1.112 | Fu: | 14.85% |
| CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.096 |
| CYP2C19-inhibitor: | 0.994 | CYP2C19-substrate: | 0.944 |
| CYP2C9-inhibitor: | 0.955 | CYP2C9-substrate: | 0.129 |
| CYP2D6-inhibitor: | 0.832 | CYP2D6-substrate: | 0.062 |
| CYP3A4-inhibitor: | 0.944 | CYP3A4-substrate: | 0.988 |
| Clearance (CL): | 7.152 | Half-life (T1/2): | 0.005 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.132 |
| Drug-inuced Liver Injury (DILI): | 0.979 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.939 | Maximum Recommended Daily Dose: | 0.848 |
| Skin Sensitization: | 0.916 | Carcinogencity: | 0.847 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.761 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003176 | ![]() |
0.926 | D0SP3D | ![]() |
0.230 | ||
| ENC003382 | ![]() |
0.840 | D01TSI | ![]() |
0.230 | ||
| ENC003381 | ![]() |
0.829 | D0E0RY | ![]() |
0.225 | ||
| ENC004849 | ![]() |
0.742 | D0W7RJ | ![]() |
0.225 | ||
| ENC003490 | ![]() |
0.732 | D0V3ZA | ![]() |
0.224 | ||
| ENC001500 | ![]() |
0.623 | D09NNH | ![]() |
0.219 | ||
| ENC004848 | ![]() |
0.565 | D0V9WF | ![]() |
0.212 | ||
| ENC002358 | ![]() |
0.429 | D0J5YC | ![]() |
0.207 | ||
| ENC003992 | ![]() |
0.425 | D0R5OS | ![]() |
0.202 | ||
| ENC003530 | ![]() |
0.411 | D04RLY | ![]() |
0.200 | ||