|
Name |
acetoxydehdroaustin B
|
| Molecular Formula | C30H36O11 | |
| IUPAC Name* |
[16-acetyloxy-5-(2-formyloxypropan-2-yl)-2,9,13-trimethyl-6,15-dimethylidene-11,14-dioxo-5-prop-1-enyl-10,12,16-trioxapentacyclo[7.5.1.17,13.01,7.02,7]hexadecan-3-yl]acetate
|
|
| SMILES |
C=C1C(C=CC)(C(C)(C)OC=O)CC(OC(C)=O)C2(C)C13OC14C(=O)OC(C)(C(=C)C12C(=O)OC4C)C3OC(C)=O
|
|
| InChI |
InChI=1S/C30H36O11/c1-11-12-27(24(7,8)36-14-31)13-20(38-18(5)32)26(10)28-15(2)25(9)21(39-19(6)33)29(26,16(27)3)41-30(28,23(35)40-25)17(4)37-22(28)34/h11-12,14,17,20-21H,2-3,13H2,1,4-10H3/b12-11-/t17-,20-,21-,25+,26-,27+,28+,29+,30-/m1/s1
|
|
| InChIKey |
SGUCLNSBSOFQCU-IGIWIHTOSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 572.61 | ALogp: | 2.7 |
| HBD: | 0 | HBA: | 11 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 140.7 | Aromatic Rings: | 5 |
| Heavy Atoms: | 41 | QED Weighted: | 0.2 |
| Caco-2 Permeability: | -5.255 | MDCK Permeability: | 0.00004330 |
| Pgp-inhibitor: | 0.628 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.881 | 20% Bioavailability (F20%): | 0.99 |
| 30% Bioavailability (F30%): | 0.931 |
| Blood-Brain-Barrier Penetration (BBB): | 0.112 | Plasma Protein Binding (PPB): | 56.10% |
| Volume Distribution (VD): | 1.848 | Fu: | 45.62% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.929 |
| CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.867 |
| CYP2C9-inhibitor: | 0.035 | CYP2C9-substrate: | 0.027 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.608 | CYP3A4-substrate: | 0.924 |
| Clearance (CL): | 1.46 | Half-life (T1/2): | 0.007 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.577 |
| Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.968 |
| Rat Oral Acute Toxicity: | 0.979 | Maximum Recommended Daily Dose: | 0.01 |
| Skin Sensitization: | 0.012 | Carcinogencity: | 0.988 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.049 |
| Respiratory Toxicity: | 0.71 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004812 | ![]() |
0.800 | D0H2MO | ![]() |
0.238 | ||
| ENC004810 | ![]() |
0.736 | D0KR9U | ![]() |
0.238 | ||
| ENC003776 | ![]() |
0.646 | D09SIK | ![]() |
0.211 | ||
| ENC003159 | ![]() |
0.646 | D0OL7F | ![]() |
0.211 | ||
| ENC005316 | ![]() |
0.646 | D0G7KJ | ![]() |
0.204 | ||
| ENC003179 | ![]() |
0.646 | D02HSB | ![]() |
0.199 | ||
| ENC004311 | ![]() |
0.636 | D0O5WP | ![]() |
0.199 | ||
| ENC006041 | ![]() |
0.609 | D06IGU | ![]() |
0.199 | ||
| ENC005315 | ![]() |
0.526 | D08BDT | ![]() |
0.196 | ||
| ENC003309 | ![]() |
0.478 | D03ZZK | ![]() |
0.195 | ||