|
Name |
1,2-Dihydro-acetoxydehydroaustin B
|
| Molecular Formula | C29H34O11 | |
| IUPAC Name* |
[(1S,2S,3R,5S,7R,8R,9S,12S,13R)-8-acetyloxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14,17-trioxapentacyclo[7.6.1.17,12.01,12.02,7]heptadecane-5,3'-oxane]-3-yl] acetate
|
|
| SMILES |
C[C@@H]1[C@@]23C(=O)O[C@@]4([C@H]([C@@]5(O2)C(=C)[C@]6(CCC(=O)OC6(C)C)C[C@H]([C@@]5([C@]3(C4=C)C(=O)O1)C)OC(=O)C)OC(=O)C)C
|
|
| InChI |
InChI=1S/C29H34O11/c1-13-24(8)20(37-17(5)31)28-14(2)26(11-10-19(32)38-23(26,6)7)12-18(36-16(4)30)25(28,9)27(13)21(33)35-15(3)29(27,40-28)22(34)39-24/h15,18,20H,1-2,10-12H2,3-9H3/t15-,18-,20-,24+,25-,26+,27+,28+,29+/m1/s1
|
|
| InChIKey |
UDKVZXSAHWTGCN-MIOOGCPZSA-N
|
|
| Synonyms |
1,2-Dihydro-acetoxydehydroaustin B
|
|
| CAS | NA | |
| PubChem CID | 139588096 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 558.6 | ALogp: | 1.0 |
| HBD: | 0 | HBA: | 11 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 141.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 40 | QED Weighted: | 0.281 |
| Caco-2 Permeability: | -5.446 | MDCK Permeability: | 0.00006730 |
| Pgp-inhibitor: | 0.256 | Pgp-substrate: | 0.049 |
| Human Intestinal Absorption (HIA): | 0.273 | 20% Bioavailability (F20%): | 0.99 |
| 30% Bioavailability (F30%): | 0.92 |
| Blood-Brain-Barrier Penetration (BBB): | 0.558 | Plasma Protein Binding (PPB): | 54.35% |
| Volume Distribution (VD): | 0.977 | Fu: | 53.66% |
| CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.967 |
| CYP2C19-inhibitor: | 0.058 | CYP2C19-substrate: | 0.515 |
| CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.008 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.03 |
| CYP3A4-inhibitor: | 0.453 | CYP3A4-substrate: | 0.846 |
| Clearance (CL): | 1.94 | Half-life (T1/2): | 0.074 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.942 |
| Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.997 |
| Rat Oral Acute Toxicity: | 0.893 | Maximum Recommended Daily Dose: | 0.034 |
| Skin Sensitization: | 0.765 | Carcinogencity: | 0.979 |
| Eye Corrosion: | 0.959 | Eye Irritation: | 0.207 |
| Respiratory Toxicity: | 0.849 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004311 | ![]() |
0.829 | D0H2MO | ![]() |
0.264 | ||
| ENC005316 | ![]() |
0.767 | D0KR9U | ![]() |
0.240 | ||
| ENC003159 | ![]() |
0.767 | D03ZZK | ![]() |
0.227 | ||
| ENC003179 | ![]() |
0.767 | D0Q4SD | ![]() |
0.226 | ||
| ENC006041 | ![]() |
0.679 | D0G7KJ | ![]() |
0.221 | ||
| ENC004811 | ![]() |
0.646 | D08BDT | ![]() |
0.221 | ||
| ENC004812 | ![]() |
0.646 | D0X4RS | ![]() |
0.209 | ||
| ENC005315 | ![]() |
0.632 | D06IGU | ![]() |
0.207 | ||
| ENC003309 | ![]() |
0.603 | D0EP0C | ![]() |
0.206 | ||
| ENC004810 | ![]() |
0.574 | D0X7XG | ![]() |
0.206 | ||