|
Name |
Hydroxydehydroaustin
|
| Molecular Formula | C27H30O10 | |
| IUPAC Name* |
(3-hydroxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14,17-trioxapentacyclo[7.6.1.17,12.01,12.02,7]heptadecane-5,3'-pyran]-8-yl)acetate
|
|
| SMILES |
C=C1C2(C=CC(=O)OC2(C)C)CC(O)C2(C)C13OC14C(=O)OC(C)(C(=C)C12C(=O)OC4C)C3OC(C)=O
|
|
| InChI |
InChI=1S/C27H30O10/c1-12-22(7)18(34-15(4)28)26-13(2)24(10-9-17(30)35-21(24,5)6)11-16(29)23(26,8)25(12)19(31)33-14(3)27(25,37-26)20(32)36-22/h9-10,14,16,18,29H,1-2,11H2,3-8H3/t14-,16?,18?,22+,23?,24+,25?,26+,27-/m0/s1
|
|
| InChIKey |
RPVGSSWTJOSAQC-IBLFXESNSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 514.53 | ALogp: | 1.4 |
| HBD: | 1 | HBA: | 10 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 134.7 | Aromatic Rings: | 6 |
| Heavy Atoms: | 37 | QED Weighted: | 0.314 |
| Caco-2 Permeability: | -5.315 | MDCK Permeability: | 0.00002920 |
| Pgp-inhibitor: | 0.939 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.929 | 20% Bioavailability (F20%): | 0.997 |
| 30% Bioavailability (F30%): | 0.968 |
| Blood-Brain-Barrier Penetration (BBB): | 0.117 | Plasma Protein Binding (PPB): | 56.21% |
| Volume Distribution (VD): | 1.165 | Fu: | 44.95% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.966 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.792 |
| CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.021 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.034 |
| CYP3A4-inhibitor: | 0.484 | CYP3A4-substrate: | 0.928 |
| Clearance (CL): | 1.644 | Half-life (T1/2): | 0.009 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.466 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.951 |
| Rat Oral Acute Toxicity: | 0.956 | Maximum Recommended Daily Dose: | 0.216 |
| Skin Sensitization: | 0.014 | Carcinogencity: | 0.973 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.26 |
| Respiratory Toxicity: | 0.873 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003159 | ![]() |
0.821 | D03ZZK | ![]() |
0.263 | ||
| ENC005316 | ![]() |
0.821 | D0KR9U | ![]() |
0.251 | ||
| ENC003179 | ![]() |
0.821 | D0H2MO | ![]() |
0.237 | ||
| ENC003309 | ![]() |
0.796 | D02QJH | ![]() |
0.235 | ||
| ENC006041 | ![]() |
0.767 | D0G7KJ | ![]() |
0.232 | ||
| ENC002849 | ![]() |
0.676 | D02JNM | ![]() |
0.224 | ||
| ENC004311 | ![]() |
0.648 | D09WYX | ![]() |
0.224 | ||
| ENC006040 | ![]() |
0.642 | D0P0HT | ![]() |
0.223 | ||
| ENC003776 | ![]() |
0.632 | D06XHC | ![]() |
0.222 | ||
| ENC002577 | ![]() |
0.569 | D0F7NQ | ![]() |
0.218 | ||