|
Name |
2-Hydroacetoxydehydroaustin
|
| Molecular Formula | C29H34O12 | |
| IUPAC Name* |
[(1S,2S,3R,5S,5'S,7R,8R,9S,12R,13R)-8-acetyloxy-5'-hydroxy-2,2',2',9,13-pentamethyl-6,16-dimethylidene-6',11,15-trioxospiro[10,14,17-trioxapentacyclo[7.6.1.17,12.01,12.02,7]heptadecane-5,3'-oxane]-3-yl] acetate
|
|
| SMILES |
C[C@@H]1[C@]23C(=O)O[C@@]4([C@H]([C@@]5(O2)C(=C)[C@]6(C[C@@H](C(=O)OC6(C)C)O)C[C@H]([C@@]5([C@]3(C4=C)C(=O)O1)C)OC(=O)C)OC(=O)C)C
|
|
| InChI |
InChI=1S/C29H34O12/c1-12-24(8)20(38-16(5)31)28-13(2)26(10-17(32)19(33)39-23(26,6)7)11-18(37-15(4)30)25(28,9)27(12)21(34)36-14(3)29(27,41-28)22(35)40-24/h14,17-18,20,32H,1-2,10-11H2,3-9H3/t14-,17+,18-,20-,24+,25-,26+,27+,28+,29-/m1/s1
|
|
| InChIKey |
AAPBNQSLXVWXNI-OFKDBGQDSA-N
|
|
| Synonyms |
2-hydroacetoxydehydroaustin
|
|
| CAS | NA | |
| PubChem CID | 156581600 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 574.6 | ALogp: | 0.4 |
| HBD: | 1 | HBA: | 12 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 161.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 41 | QED Weighted: | 0.289 |
| Caco-2 Permeability: | -5.431 | MDCK Permeability: | 0.00004880 |
| Pgp-inhibitor: | 0.103 | Pgp-substrate: | 0.584 |
| Human Intestinal Absorption (HIA): | 0.521 | 20% Bioavailability (F20%): | 0.986 |
| 30% Bioavailability (F30%): | 0.778 |
| Blood-Brain-Barrier Penetration (BBB): | 0.202 | Plasma Protein Binding (PPB): | 59.48% |
| Volume Distribution (VD): | 1.05 | Fu: | 47.23% |
| CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.967 |
| CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.721 |
| CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.011 |
| CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.064 |
| CYP3A4-inhibitor: | 0.161 | CYP3A4-substrate: | 0.742 |
| Clearance (CL): | 1.802 | Half-life (T1/2): | 0.357 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.909 |
| Drug-inuced Liver Injury (DILI): | 0.948 | AMES Toxicity: | 0.992 |
| Rat Oral Acute Toxicity: | 0.954 | Maximum Recommended Daily Dose: | 0.02 |
| Skin Sensitization: | 0.64 | Carcinogencity: | 0.968 |
| Eye Corrosion: | 0.277 | Eye Irritation: | 0.345 |
| Respiratory Toxicity: | 0.746 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003776 | ![]() |
0.829 | D0H2MO | ![]() |
0.269 | ||
| ENC003179 | ![]() |
0.754 | D0KR9U | ![]() |
0.266 | ||
| ENC003159 | ![]() |
0.754 | D03ZZK | ![]() |
0.239 | ||
| ENC005316 | ![]() |
0.754 | D0G7KJ | ![]() |
0.233 | ||
| ENC006041 | ![]() |
0.669 | D08BDT | ![]() |
0.226 | ||
| ENC005315 | ![]() |
0.648 | D09SIK | ![]() |
0.211 | ||
| ENC004811 | ![]() |
0.636 | D0OL7F | ![]() |
0.211 | ||
| ENC004812 | ![]() |
0.636 | D0X7XG | ![]() |
0.211 | ||
| ENC003309 | ![]() |
0.581 | D06IGU | ![]() |
0.210 | ||
| ENC004810 | ![]() |
0.566 | D09WYX | ![]() |
0.210 | ||