|
Name |
Stemphone
|
| Molecular Formula | C30H42O8 | |
| IUPAC Name* |
[(E,2S,3S)-2-[(3R,4aR,6aR,12S,12aS,12bR)-12-hydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-8,11-dioxo-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]-4-methylhex-4-en-3-yl] acetate
|
|
| SMILES |
C/C=C(\C)/[C@H]([C@@H](C)C1=CC(=O)C2=C(C1=O)O[C@@]3(CC[C@@H]4[C@@]([C@H]3[C@@H]2O)(CC[C@@H](O4)C(C)(C)O)C)C)OC(=O)C
|
|
| InChI |
InChI=1S/C30H42O8/c1-9-15(2)25(36-17(4)31)16(3)18-14-19(32)22-24(34)27-29(7)12-10-20(28(5,6)35)37-21(29)11-13-30(27,8)38-26(22)23(18)33/h9,14,16,20-21,24-25,27,34-35H,10-13H2,1-8H3/b15-9+/t16-,20+,21+,24+,25+,27+,29-,30+/m0/s1
|
|
| InChIKey |
CGFWCZMBHASRBJ-CCZFOCGKSA-N
|
|
| Synonyms |
Stemphone; 54854-92-1; [(E,2S,3S)-2-[(3R,4aR,6aR,12S,12aS,12bR)-12-hydroxy-3-(2-hydroxypropan-2-yl)-6a,12b-dimethyl-8,11-dioxo-1,2,3,4a,5,6,12,12a-octahydropyrano[3,2-a]xanthen-9-yl]-4-methylhex-4-en-3-yl] acetate; Cochlioquinone A, 21,22-didehydro-, (21E)-; CHEMBL2288178; BDBM50529932
|
|
| CAS | 54854-92-1 | |
| PubChem CID | 6441692 | |
| ChEMBL ID | CHEMBL2288178 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 530.6 | ALogp: | 3.2 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 119.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 38 | QED Weighted: | 0.304 |
| Caco-2 Permeability: | -4.798 | MDCK Permeability: | 0.00001550 |
| Pgp-inhibitor: | 0.861 | Pgp-substrate: | 0.064 |
| Human Intestinal Absorption (HIA): | 0.065 | 20% Bioavailability (F20%): | 0.017 |
| 30% Bioavailability (F30%): | 0.063 |
| Blood-Brain-Barrier Penetration (BBB): | 0.151 | Plasma Protein Binding (PPB): | 99.14% |
| Volume Distribution (VD): | 1.025 | Fu: | 4.54% |
| CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.228 |
| CYP2C19-inhibitor: | 0.056 | CYP2C19-substrate: | 0.481 |
| CYP2C9-inhibitor: | 0.342 | CYP2C9-substrate: | 0.33 |
| CYP2D6-inhibitor: | 0.196 | CYP2D6-substrate: | 0.145 |
| CYP3A4-inhibitor: | 0.477 | CYP3A4-substrate: | 0.466 |
| Clearance (CL): | 1.85 | Half-life (T1/2): | 0.083 |
| hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.935 |
| Drug-inuced Liver Injury (DILI): | 0.546 | AMES Toxicity: | 0.058 |
| Rat Oral Acute Toxicity: | 0.817 | Maximum Recommended Daily Dose: | 0.817 |
| Skin Sensitization: | 0.141 | Carcinogencity: | 0.015 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.07 |
| Respiratory Toxicity: | 0.112 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000943 | ![]() |
0.788 | D0W5LS | ![]() |
0.262 | ||
| ENC002182 | ![]() |
0.786 | D0V2JK | ![]() |
0.250 | ||
| ENC004572 | ![]() |
0.786 | D0W2EK | ![]() |
0.250 | ||
| ENC002674 | ![]() |
0.717 | D0X7XG | ![]() |
0.250 | ||
| ENC003011 | ![]() |
0.600 | D02CJX | ![]() |
0.248 | ||
| ENC004571 | ![]() |
0.561 | D0X4RS | ![]() |
0.241 | ||
| ENC003638 | ![]() |
0.548 | D0H2MO | ![]() |
0.241 | ||
| ENC005796 | ![]() |
0.548 | D08BDT | ![]() |
0.236 | ||
| ENC002924 | ![]() |
0.540 | D09WYX | ![]() |
0.235 | ||
| ENC004573 | ![]() |
0.523 | D04SFH | ![]() |
0.234 | ||