|
Name |
Isocochlioquinone D
|
| Molecular Formula | C30H43NO7S | |
| IUPAC Name* |
2,11-dihydroxy-19-(2-hydroxypropan-2-yl)-14,22-dimethyl-10-(4-methyl-3-oxohexan-2-yl)-13,18-dioxa-8-thia-5-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10-trien-6-one
|
|
| SMILES |
CCC(C)C(=O)C(C)c1c(O)c2c(c3c1SCC(=O)N3)C(O)C1C(C)(CCC3OC(C(C)(C)O)CCC31C)O2
|
|
| InChI |
InChI=1S/C30H43NO7S/c1-8-14(2)22(33)15(3)19-23(34)25-20(21-26(19)39-13-18(32)31-21)24(35)27-29(6)11-9-16(28(4,5)36)37-17(29)10-12-30(27,7)38-25/h14-17,24,27,34-36H,8-13H2,1-7H3,(H,31,32)/t14-,15-,16+,17+,24+,27+,29-,30+/m0/s1
|
|
| InChIKey |
AJCPALIONDTISA-JPOZSSEASA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 561.74 | ALogp: | 5.1 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 125.3 | Aromatic Rings: | 5 |
| Heavy Atoms: | 39 | QED Weighted: | 0.352 |
| Caco-2 Permeability: | -4.729 | MDCK Permeability: | 0.00001600 |
| Pgp-inhibitor: | 0.626 | Pgp-substrate: | 0.929 |
| Human Intestinal Absorption (HIA): | 0.073 | 20% Bioavailability (F20%): | 0.034 |
| 30% Bioavailability (F30%): | 0.008 |
| Blood-Brain-Barrier Penetration (BBB): | 0.867 | Plasma Protein Binding (PPB): | 98.55% |
| Volume Distribution (VD): | 1.189 | Fu: | 1.59% |
| CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.836 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.881 |
| CYP2C9-inhibitor: | 0.075 | CYP2C9-substrate: | 0.846 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.138 |
| CYP3A4-inhibitor: | 0.478 | CYP3A4-substrate: | 0.799 |
| Clearance (CL): | 6.319 | Half-life (T1/2): | 0.252 |
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.35 |
| Drug-inuced Liver Injury (DILI): | 0.791 | AMES Toxicity: | 0.068 |
| Rat Oral Acute Toxicity: | 0.985 | Maximum Recommended Daily Dose: | 0.837 |
| Skin Sensitization: | 0.167 | Carcinogencity: | 0.062 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.873 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002674 | ![]() |
0.610 | D0W2EK | ![]() |
0.244 | ||
| ENC003006 | ![]() |
0.597 | D0W5LS | ![]() |
0.230 | ||
| ENC003638 | ![]() |
0.531 | D0Y7LD | ![]() |
0.229 | ||
| ENC005796 | ![]() |
0.519 | D08IWD | ![]() |
0.226 | ||
| ENC000943 | ![]() |
0.504 | D0M4WA | ![]() |
0.222 | ||
| ENC004251 | ![]() |
0.493 | D0N1TP | ![]() |
0.222 | ||
| ENC005795 | ![]() |
0.478 | D05CHI | ![]() |
0.222 | ||
| ENC003007 | ![]() |
0.467 | D0X7XG | ![]() |
0.222 | ||
| ENC004570 | ![]() |
0.465 | D04VIS | ![]() |
0.218 | ||
| ENC005797 | ![]() |
0.463 | D02IQY | ![]() |
0.217 | ||