![]() |
Name |
Dehydrofukinone
|
Molecular Formula | C15H22O | |
IUPAC Name* |
(4aR,5S)-4a,5-dimethyl-3-propan-2-ylidene-5,6,7,8-tetrahydro-4H-naphthalen-2-one
|
|
SMILES |
C[C@H]1CCCC2=CC(=O)C(=C(C)C)C[C@]12C
|
|
InChI |
InChI=1S/C15H22O/c1-10(2)13-9-15(4)11(3)6-5-7-12(15)8-14(13)16/h8,11H,5-7,9H2,1-4H3/t11-,15+/m0/s1
|
|
InChIKey |
DZOKWSREAZGFFC-XHDPSFHLSA-N
|
|
Synonyms |
Dehydrofukinone; Isopetasan; 19598-45-9; 9,10-Dehydrofukinone; Fukinone, 9,10-dehydro-; FX7D1QL7L0; (4aR,5S)-4a,5-dimethyl-3-propan-2-ylidene-5,6,7,8-tetrahydro-4H-naphthalen-2-one; 2(3H)-Naphthalenone, 4,4a,5,6,7,8-hexahydro-4a,5-dimethyl-3-(1-methylethylidene)-, (4ar-cis)-; UNII-FX7D1QL7L0; 3-DESOXYISOPETASOL; FUKINONE, DEHYDRO-; CHEMBL4279045; DTXSID50173258; EREMOPHILA-7(11),9-DIEN-8-ONE; Q27278243; 4a,5-Dimethyl-3-(1-methylethylidene)-4,4a,5,6,7,8-hexahydro-2(3H)-naphthalenone #; 2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-4A,5-DIMETHYL-3-(1-METHYLETHYLIDENE)-, (4AR,5S)-
|
|
CAS | 19598-45-9 | |
PubChem CID | 177072 | |
ChEMBL ID | CHEMBL4279045 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 218.33 | ALogp: | 4.1 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.54 |
Caco-2 Permeability: | -4.627 | MDCK Permeability: | 0.00001300 |
Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.913 |
30% Bioavailability (F30%): | 0.591 |
Blood-Brain-Barrier Penetration (BBB): | 0.069 | Plasma Protein Binding (PPB): | 94.15% |
Volume Distribution (VD): | 1.41 | Fu: | 5.31% |
CYP1A2-inhibitor: | 0.925 | CYP1A2-substrate: | 0.907 |
CYP2C19-inhibitor: | 0.84 | CYP2C19-substrate: | 0.919 |
CYP2C9-inhibitor: | 0.527 | CYP2C9-substrate: | 0.576 |
CYP2D6-inhibitor: | 0.862 | CYP2D6-substrate: | 0.49 |
CYP3A4-inhibitor: | 0.429 | CYP3A4-substrate: | 0.518 |
Clearance (CL): | 6.322 | Half-life (T1/2): | 0.704 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.542 |
Drug-inuced Liver Injury (DILI): | 0.152 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.281 | Maximum Recommended Daily Dose: | 0.662 |
Skin Sensitization: | 0.934 | Carcinogencity: | 0.792 |
Eye Corrosion: | 0.646 | Eye Irritation: | 0.82 |
Respiratory Toxicity: | 0.972 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001829 | ![]() |
0.424 | D07BSQ | ![]() |
0.274 | ||
ENC001437 | ![]() |
0.424 | D04SFH | ![]() |
0.261 | ||
ENC000949 | ![]() |
0.410 | D04GJN | ![]() |
0.261 | ||
ENC001082 | ![]() |
0.385 | D0I2SD | ![]() |
0.261 | ||
ENC003895 | ![]() |
0.385 | D0I5DS | ![]() |
0.261 | ||
ENC001183 | ![]() |
0.355 | D0G8BV | ![]() |
0.259 | ||
ENC001526 | ![]() |
0.354 | D0X4RS | ![]() |
0.258 | ||
ENC004128 | ![]() |
0.354 | D00ETS | ![]() |
0.254 | ||
ENC005062 | ![]() |
0.348 | D0Z1XD | ![]() |
0.253 | ||
ENC001078 | ![]() |
0.348 | D0IX6I | ![]() |
0.253 |