|
Name |
Calbistrin F
|
| Molecular Formula | C28H44O7 | |
| IUPAC Name* |
[(1S,3R,4aR,7S,8S,8aS)-8-(3-hydroxypropanoyl)-3,7,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalen-1-yl] (2S,3R,4E,6E,8S,9R)-3,8,9-trihydroxy-2,4-dimethyldeca-4,6-dienoate
|
|
| SMILES |
C[C@@H]1C[C@@H]2C=C[C@@H]([C@]([C@H]2[C@H](C1)OC(=O)[C@@H](C)[C@H](/C(=C/C=C/[C@@H]([C@@H](C)O)O)/C)O)(C)C(=O)CCO)C
|
|
| InChI |
InChI=1S/C28H44O7/c1-16-14-21-11-10-18(3)28(6,24(32)12-13-29)25(21)23(15-16)35-27(34)19(4)26(33)17(2)8-7-9-22(31)20(5)30/h7-11,16,18-23,25-26,29-31,33H,12-15H2,1-6H3/b9-7+,17-8+/t16-,18+,19+,20-,21+,22+,23+,25-,26+,28-/m1/s1
|
|
| InChIKey |
ZGRACCPMOXYOKT-RXZQRYLVSA-N
|
|
| Synonyms |
Calbistrin F; CHEMBL3358712; [(1S,3R,4aR,7S,8S,8aS)-8-(3-hydroxypropanoyl)-3,7,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalen-1-yl] (2S,3R,4E,6E,8S,9R)-3,8,9-trihydroxy-2,4-dimethyl-deca-4,6-dienoate
|
|
| CAS | NA | |
| PubChem CID | 118723026 | |
| ChEMBL ID | CHEMBL3358712 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 492.6 | ALogp: | 3.0 |
| HBD: | 4 | HBA: | 7 |
| Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 124.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 35 | QED Weighted: | 0.208 |
| Caco-2 Permeability: | -4.98 | MDCK Permeability: | 0.00010983 |
| Pgp-inhibitor: | 0.968 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.126 | 20% Bioavailability (F20%): | 0.112 |
| 30% Bioavailability (F30%): | 0.914 |
| Blood-Brain-Barrier Penetration (BBB): | 0.285 | Plasma Protein Binding (PPB): | 50.47% |
| Volume Distribution (VD): | 0.437 | Fu: | 16.14% |
| CYP1A2-inhibitor: | 0.086 | CYP1A2-substrate: | 0.15 |
| CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.795 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.285 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.081 |
| CYP3A4-inhibitor: | 0.795 | CYP3A4-substrate: | 0.485 |
| Clearance (CL): | 6.56 | Half-life (T1/2): | 0.812 |
| hERG Blockers: | 0.084 | Human Hepatotoxicity (H-HT): | 0.698 |
| Drug-inuced Liver Injury (DILI): | 0.663 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.477 | Maximum Recommended Daily Dose: | 0.022 |
| Skin Sensitization: | 0.257 | Carcinogencity: | 0.062 |
| Eye Corrosion: | 0.006 | Eye Irritation: | 0.031 |
| Respiratory Toxicity: | 0.861 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003293 | ![]() |
0.825 | D02RQU | ![]() |
0.270 | ||
| ENC003294 | ![]() |
0.721 | D0E9KA | ![]() |
0.232 | ||
| ENC003119 | ![]() |
0.373 | D06WTZ | ![]() |
0.227 | ||
| ENC004660 | ![]() |
0.344 | D0X7XG | ![]() |
0.215 | ||
| ENC003665 | ![]() |
0.336 | D03JSJ | ![]() |
0.204 | ||
| ENC003895 | ![]() |
0.333 | D0F7NQ | ![]() |
0.201 | ||
| ENC003781 | ![]() |
0.333 | D0G7KJ | ![]() |
0.200 | ||
| ENC003792 | ![]() |
0.330 | D03IKT | ![]() |
0.200 | ||
| ENC004127 | ![]() |
0.324 | D0H0ND | ![]() |
0.199 | ||
| ENC003775 | ![]() |
0.321 | D05ZTH | ![]() |
0.196 | ||