|
Name |
6-Formamide-chetomin
|
| Molecular Formula | C33H32N6O7S4 | |
| IUPAC Name* |
(1S,3S,11R,14S)-10-acetyl-14-(hydroxymethyl)-3-[3-[[(1S,4S)-4-(hydroxymethyl)-5,7-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]methyl]indol-1-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
| SMILES |
CC(=O)N1[C@H]2[C@](C[C@@]34N2C(=O)[C@@](N(C3=O)C)(SS4)CO)(C5=CC=CC=C51)N6C=C(C7=CC=CC=C76)C[C@]89C(=O)N([C@](C(=O)N8C)(SS9)CO)C
|
|
| InChI |
InChI=1S/C33H32N6O7S4/c1-18(42)38-23-12-8-6-10-21(23)29(15-31-26(44)36(4)33(17-41,50-48-31)28(46)39(31)24(29)38)37-14-19(20-9-5-7-11-22(20)37)13-30-25(43)35(3)32(16-40,49-47-30)27(45)34(30)2/h5-12,14,24,40-41H,13,15-17H2,1-4H3/t24-,29+,30+,31+,32+,33+/m1/s1
|
|
| InChIKey |
HRFTYMQNNGUHMI-ZIBPZDQUSA-N
|
|
| Synonyms |
6-formamide-chetomin
|
|
| CAS | NA | |
| PubChem CID | 139591676 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 752.9 | ALogp: | 1.3 |
| HBD: | 2 | HBA: | 11 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 248.0 | Aromatic Rings: | 11 |
| Heavy Atoms: | 50 | QED Weighted: | 0.371 |
| Caco-2 Permeability: | -5.666 | MDCK Permeability: | 0.00002090 |
| Pgp-inhibitor: | 0.483 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.755 | 20% Bioavailability (F20%): | 0.924 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.07 | Plasma Protein Binding (PPB): | 82.76% |
| Volume Distribution (VD): | 1.121 | Fu: | 5.77% |
| CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.169 |
| CYP2C19-inhibitor: | 0.95 | CYP2C19-substrate: | 0.979 |
| CYP2C9-inhibitor: | 0.974 | CYP2C9-substrate: | 0.416 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.019 |
| CYP3A4-inhibitor: | 0.94 | CYP3A4-substrate: | 0.996 |
| Clearance (CL): | 7.388 | Half-life (T1/2): | 0.003 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.69 |
| Drug-inuced Liver Injury (DILI): | 0.996 | AMES Toxicity: | 0.016 |
| Rat Oral Acute Toxicity: | 0.921 | Maximum Recommended Daily Dose: | 0.028 |
| Skin Sensitization: | 0.889 | Carcinogencity: | 0.697 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.001 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003455 | ![]() |
0.807 | D0V9WF | ![]() |
0.251 | ||
| ENC002642 | ![]() |
0.627 | D0SP3D | ![]() |
0.231 | ||
| ENC004867 | ![]() |
0.484 | D0E3OF | ![]() |
0.229 | ||
| ENC002348 | ![]() |
0.484 | D01TSI | ![]() |
0.224 | ||
| ENC002354 | ![]() |
0.444 | D02TJS | ![]() |
0.221 | ||
| ENC001500 | ![]() |
0.399 | D0U3EC | ![]() |
0.220 | ||
| ENC004848 | ![]() |
0.396 | D09NNH | ![]() |
0.219 | ||
| ENC003382 | ![]() |
0.392 | D0V3ZA | ![]() |
0.219 | ||
| ENC004849 | ![]() |
0.382 | D0N6RF | ![]() |
0.218 | ||
| ENC003176 | ![]() |
0.362 | D07NVU | ![]() |
0.218 | ||