|
Name |
Dethio-tetra(methylyhio)chetomin
|
| Molecular Formula | C35H42N6O6S4 | |
| IUPAC Name* |
(1R,4S,7S,9S)-4-(hydroxymethyl)-9-[3-[[(2S,5S)-5-(hydroxymethyl)-1,4-dimethyl-2,5-bis(methylsulfanyl)-3,6-dioxopiperazin-2-yl]methyl]indol-1-yl]-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione
|
|
| SMILES |
CN1C(=O)[C@](N(C(=O)[C@]1(CC2=CN(C3=CC=CC=C32)[C@]45C[C@@]6(C(=O)N([C@@](C(=O)N6[C@H]4NC7=CC=CC=C57)(CO)SC)C)SC)SC)C)(CO)SC
|
|
| InChI |
InChI=1S/C35H42N6O6S4/c1-37-29(46)34(19-42,50-6)38(2)27(44)32(37,48-4)16-21-17-40(25-15-11-8-12-22(21)25)31-18-33(49-5)28(45)39(3)35(20-43,51-7)30(47)41(33)26(31)36-24-14-10-9-13-23(24)31/h8-15,17,26,36,42-43H,16,18-20H2,1-7H3/t26-,31+,32+,33+,34+,35+/m1/s1
|
|
| InChIKey |
YDUJBQZOCBSEQA-JLYHLUBJSA-N
|
|
| Synonyms |
CHEMBL510163; Dethio-tetra(methylyhio)chetomin; dethio-tetra(methylthio) chetomin
|
|
| CAS | NA | |
| PubChem CID | 16040180 | |
| ChEMBL ID | CHEMBL510163 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 771.0 | ALogp: | 3.6 |
| HBD: | 3 | HBA: | 11 |
| Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 240.0 | Aromatic Rings: | 7 |
| Heavy Atoms: | 51 | QED Weighted: | 0.296 |
| Caco-2 Permeability: | -5.536 | MDCK Permeability: | 0.00000836 |
| Pgp-inhibitor: | 0.811 | Pgp-substrate: | 0.968 |
| Human Intestinal Absorption (HIA): | 0.67 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.056 |
| Blood-Brain-Barrier Penetration (BBB): | 0.227 | Plasma Protein Binding (PPB): | 95.93% |
| Volume Distribution (VD): | 1.705 | Fu: | 2.08% |
| CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.666 |
| CYP2C19-inhibitor: | 0.967 | CYP2C19-substrate: | 0.973 |
| CYP2C9-inhibitor: | 0.967 | CYP2C9-substrate: | 0.092 |
| CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.015 |
| CYP3A4-inhibitor: | 0.978 | CYP3A4-substrate: | 0.994 |
| Clearance (CL): | 6.668 | Half-life (T1/2): | 0.006 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.302 |
| Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.004 |
| Rat Oral Acute Toxicity: | 0.751 | Maximum Recommended Daily Dose: | 0.011 |
| Skin Sensitization: | 0.797 | Carcinogencity: | 0.41 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004867 | ![]() |
1.000 | D0V9WF | ![]() |
0.257 | ||
| ENC002642 | ![]() |
0.769 | D02TJS | ![]() |
0.220 | ||
| ENC002354 | ![]() |
0.605 | D0SP3D | ![]() |
0.219 | ||
| ENC003455 | ![]() |
0.581 | D01TSI | ![]() |
0.218 | ||
| ENC003978 | ![]() |
0.484 | D0J5YC | ![]() |
0.214 | ||
| ENC001500 | ![]() |
0.361 | D09NNH | ![]() |
0.213 | ||
| ENC004848 | ![]() |
0.359 | D0V3ZA | ![]() |
0.212 | ||
| ENC003382 | ![]() |
0.355 | D07VHR | ![]() |
0.212 | ||
| ENC003176 | ![]() |
0.354 | D07NVU | ![]() |
0.211 | ||
| ENC004849 | ![]() |
0.346 | D0U8UV | ![]() |
0.208 | ||