|
Name |
Asperterpene I
|
| Molecular Formula | C27H40O9 | |
| IUPAC Name* |
methyl (1R,2S,4aS,4bS,7R,8aS,10S,10aS)-7,10-dihydroxy-2-[(2S)-2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl]-2,4b,8,8,10a-pentamethyl-3-methylidene-9-oxo-1,4,4a,5,6,7,8a,10-octahydrophenanthrene-1-carboxylate
|
|
| SMILES |
C[C@@]12CC[C@H](C([C@H]1C(=O)[C@H]([C@]3([C@H]2CC(=C)[C@@]([C@@H]3C(=O)OC)(C)C(=O)[C@@](C)(C(=O)OC)O)C)O)(C)C)O
|
|
| InChI |
InChI=1S/C27H40O9/c1-13-12-14-24(4)11-10-15(28)23(2,3)17(24)16(29)19(30)26(14,6)18(20(31)35-8)25(13,5)21(32)27(7,34)22(33)36-9/h14-15,17-19,28,30,34H,1,10-12H2,2-9H3/t14-,15+,17+,18-,19+,24-,25+,26-,27-/m0/s1
|
|
| InChIKey |
IIUYCUAFSQXIAZ-XNCNABBASA-N
|
|
| Synonyms |
CHEMBL4218151; Asperterpene I; BDBM50459482
|
|
| CAS | NA | |
| PubChem CID | 139590116 | |
| ChEMBL ID | CHEMBL4218151 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 508.6 | ALogp: | 1.8 |
| HBD: | 3 | HBA: | 9 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 147.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 36 | QED Weighted: | 0.295 |
| Caco-2 Permeability: | -5.675 | MDCK Permeability: | 0.00013126 |
| Pgp-inhibitor: | 0.832 | Pgp-substrate: | 0.991 |
| Human Intestinal Absorption (HIA): | 0.042 | 20% Bioavailability (F20%): | 0.022 |
| 30% Bioavailability (F30%): | 0.39 |
| Blood-Brain-Barrier Penetration (BBB): | 0.206 | Plasma Protein Binding (PPB): | 39.37% |
| Volume Distribution (VD): | 0.599 | Fu: | 64.92% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.962 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.764 |
| CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.036 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.029 |
| CYP3A4-inhibitor: | 0.872 | CYP3A4-substrate: | 0.831 |
| Clearance (CL): | 3.66 | Half-life (T1/2): | 0.072 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.402 |
| Drug-inuced Liver Injury (DILI): | 0.425 | AMES Toxicity: | 0.058 |
| Rat Oral Acute Toxicity: | 0.537 | Maximum Recommended Daily Dose: | 0.548 |
| Skin Sensitization: | 0.074 | Carcinogencity: | 0.524 |
| Eye Corrosion: | 0.788 | Eye Irritation: | 0.127 |
| Respiratory Toxicity: | 0.987 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003850 | ![]() |
0.573 | D0H2MO | ![]() |
0.299 | ||
| ENC006004 | ![]() |
0.552 | D0F7NQ | ![]() |
0.260 | ||
| ENC003564 | ![]() |
0.364 | D0X7XG | ![]() |
0.257 | ||
| ENC005965 | ![]() |
0.329 | D0G7KJ | ![]() |
0.250 | ||
| ENC001949 | ![]() |
0.321 | D08BDT | ![]() |
0.250 | ||
| ENC004115 | ![]() |
0.319 | D01ZOG | ![]() |
0.243 | ||
| ENC005964 | ![]() |
0.312 | D0W5LS | ![]() |
0.243 | ||
| ENC002152 | ![]() |
0.309 | D04VIS | ![]() |
0.240 | ||
| ENC002162 | ![]() |
0.304 | D0X2LV | ![]() |
0.239 | ||
| ENC005963 | ![]() |
0.301 | D03MTN | ![]() |
0.233 | ||