|
Name |
Terretonin A
|
| Molecular Formula | C26H32O8 | |
| IUPAC Name* |
methyl (2R,4aS,4bR,10aR,10bR,12aR)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydro-4aH-naphtho[1,2-h]isochromene-2-carboxylate
|
|
| SMILES |
C[C@]12CCC(=O)C(C1=C(C(=O)[C@@]3([C@@H]2CC(=C)[C@]4([C@H]3C(=O)O[C@@](C4=O)(C)C(=O)OC)C)C)O)(C)C
|
|
| InChI |
InChI=1S/C26H32O8/c1-12-11-13-23(4)10-9-14(27)22(2,3)16(23)15(28)18(29)25(13,6)17-19(30)34-26(7,21(32)33-8)20(31)24(12,17)5/h13,17,28H,1,9-11H2,2-8H3/t13-,17-,23-,24+,25-,26-/m1/s1
|
|
| InChIKey |
GTEJJXOFLPCZGJ-DOFPOEDPSA-N
|
|
| Synonyms |
Terretonin A; methyl (2R,4aS,4bR,10aR,10bR,12aR)-6-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydro-4aH-naphtho[1,2-h]isochromene-2-carboxylate; CHEMBL470042; BDBM50478873; 865092-86-0
|
|
| CAS | NA | |
| PubChem CID | 11547355 | |
| ChEMBL ID | CHEMBL470042 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 472.5 | ALogp: | 2.2 |
| HBD: | 1 | HBA: | 8 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 124.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 34 | QED Weighted: | 0.347 |
| Caco-2 Permeability: | -5.265 | MDCK Permeability: | 0.00003370 |
| Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.033 | 20% Bioavailability (F20%): | 0.752 |
| 30% Bioavailability (F30%): | 0.878 |
| Blood-Brain-Barrier Penetration (BBB): | 0.384 | Plasma Protein Binding (PPB): | 67.31% |
| Volume Distribution (VD): | 0.352 | Fu: | 34.98% |
| CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.955 |
| CYP2C19-inhibitor: | 0.108 | CYP2C19-substrate: | 0.878 |
| CYP2C9-inhibitor: | 0.082 | CYP2C9-substrate: | 0.055 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.088 |
| CYP3A4-inhibitor: | 0.834 | CYP3A4-substrate: | 0.804 |
| Clearance (CL): | 3.099 | Half-life (T1/2): | 0.642 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.114 |
| Drug-inuced Liver Injury (DILI): | 0.807 | AMES Toxicity: | 0.238 |
| Rat Oral Acute Toxicity: | 0.061 | Maximum Recommended Daily Dose: | 0.082 |
| Skin Sensitization: | 0.072 | Carcinogencity: | 0.035 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.743 |
| Respiratory Toxicity: | 0.281 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005250 | ![]() |
0.776 | D0H2MO | ![]() |
0.236 | ||
| ENC003284 | ![]() |
0.712 | D0Q4SD | ![]() |
0.229 | ||
| ENC002369 | ![]() |
0.712 | D0X4RS | ![]() |
0.219 | ||
| ENC006004 | ![]() |
0.558 | D0EP0C | ![]() |
0.216 | ||
| ENC003850 | ![]() |
0.552 | D0D2VS | ![]() |
0.211 | ||
| ENC003376 | ![]() |
0.392 | D0Y2YP | ![]() |
0.211 | ||
| ENC002033 | ![]() |
0.385 | D04GJN | ![]() |
0.209 | ||
| ENC005629 | ![]() |
0.341 | D0IX6I | ![]() |
0.205 | ||
| ENC005403 | ![]() |
0.325 | D06IIB | ![]() |
0.203 | ||
| ENC005318 | ![]() |
0.324 | D0I2SD | ![]() |
0.200 | ||