|
Name |
andrastin G
|
| Molecular Formula | C28H38O8 | |
| IUPAC Name* |
methyl3-acetyloxy-10-formyl-11,15-dihydroxy-4,4,8,13,16-pentamethyl-12-methylidene-17-oxo-2,3,5,6,7,9,11-octahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
|
|
| SMILES |
C=C1C(O)C2C3(C=O)CCC(OC(C)=O)C(C)(C)C3CCC2(C)C2(C(=O)OC)C(O)=C(C)C(=O)C12C
|
|
| InChI |
InChI=1S/C28H38O8/c1-14-21(32)26(7)15(2)19(31)20-25(6,28(26,22(14)33)23(34)35-8)11-9-17-24(4,5)18(36-16(3)30)10-12-27(17,20)13-29/h13,17-20,31,33H,2,9-12H2,1,3-8H3/t17-,18+,19-,20-,25+,26-,27+,28+/m1/s1
|
|
| InChIKey |
DXKCTWUHBLVQCN-AHIHPHIDSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 502.6 | ALogp: | 3.5 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 127.2 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.334 |
| Caco-2 Permeability: | -5.326 | MDCK Permeability: | 0.00002720 |
| Pgp-inhibitor: | 0.689 | Pgp-substrate: | 0.302 |
| Human Intestinal Absorption (HIA): | 0.184 | 20% Bioavailability (F20%): | 0.449 |
| 30% Bioavailability (F30%): | 0.764 |
| Blood-Brain-Barrier Penetration (BBB): | 0.668 | Plasma Protein Binding (PPB): | 55.41% |
| Volume Distribution (VD): | 0.96 | Fu: | 45.49% |
| CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.754 |
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.802 |
| CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.108 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.086 |
| CYP3A4-inhibitor: | 0.751 | CYP3A4-substrate: | 0.857 |
| Clearance (CL): | 5.472 | Half-life (T1/2): | 0.043 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.12 |
| Drug-inuced Liver Injury (DILI): | 0.647 | AMES Toxicity: | 0.124 |
| Rat Oral Acute Toxicity: | 0.921 | Maximum Recommended Daily Dose: | 0.042 |
| Skin Sensitization: | 0.005 | Carcinogencity: | 0.068 |
| Eye Corrosion: | 0.349 | Eye Irritation: | 0.363 |
| Respiratory Toxicity: | 0.809 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003457 | ![]() |
0.617 | D0H2MO | ![]() |
0.322 | ||
| ENC004115 | ![]() |
0.607 | D0X7XG | ![]() |
0.295 | ||
| ENC005963 | ![]() |
0.607 | D0V2JK | ![]() |
0.273 | ||
| ENC001949 | ![]() |
0.605 | D08BDT | ![]() |
0.264 | ||
| ENC002012 | ![]() |
0.603 | D0X4RS | ![]() |
0.263 | ||
| ENC003138 | ![]() |
0.524 | D03MTN | ![]() |
0.257 | ||
| ENC005964 | ![]() |
0.488 | D04GJN | ![]() |
0.256 | ||
| ENC002033 | ![]() |
0.446 | D01ZOG | ![]() |
0.248 | ||
| ENC006004 | ![]() |
0.358 | D02CNR | ![]() |
0.248 | ||
| ENC001980 | ![]() |
0.356 | D09WYX | ![]() |
0.247 | ||