|
Name |
Andrastin C
|
| Molecular Formula | C28H40O6 | |
| IUPAC Name* |
methyl (3S,5S,8S,9S,10R,13R,14R)-3-acetyloxy-17-hydroxy-4,4,8,10,12,13,16-heptamethyl-15-oxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
|
|
| SMILES |
CC1=C[C@H]2[C@@]3(CC[C@@H](C([C@H]3CC[C@@]2([C@]4([C@@]1(C(=C(C4=O)C)O)C)C(=O)OC)C)(C)C)OC(=O)C)C
|
|
| InChI |
InChI=1S/C28H40O6/c1-15-14-19-25(6)12-11-20(34-17(3)29)24(4,5)18(25)10-13-26(19,7)28(23(32)33-9)22(31)16(2)21(30)27(15,28)8/h14,18-20,30H,10-13H2,1-9H3/t18-,19+,20+,25-,26+,27+,28-/m1/s1
|
|
| InChIKey |
AWMJEDMVXAOTQZ-QUQNHZJXSA-N
|
|
| Synonyms |
Andrastin C; DTXSID20894024; CHEBI:142867; methyl (3beta,5beta,8alpha,9beta,10alpha,13alpha)-3-(acetyloxy)-15-hydroxy-4,4,8,12,16-pentamethyl-17-oxoandrosta-11,15-diene-14-carboxylate; methyl (3S,5S,8S,9S,10R,13R,14R)-3-acetyloxy-17-hydroxy-4,4,8,10,12,13,16-heptamethyl-15-oxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate; methyl 3beta-(acetyloxy)-15-hydroxy-4,4,8alpha,12,16-pentamethyl-17-oxo-5beta,9beta,10alpha,13alpha-androsta-11,15-diene-14-carboxylate
|
|
| CAS | NA | |
| PubChem CID | 9982260 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 472.6 | ALogp: | 5.2 |
| HBD: | 1 | HBA: | 6 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 89.9 | Aromatic Rings: | 4 |
| Heavy Atoms: | 34 | QED Weighted: | 0.321 |
| Caco-2 Permeability: | -4.939 | MDCK Permeability: | 0.00001570 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.785 |
| 30% Bioavailability (F30%): | 0.893 |
| Blood-Brain-Barrier Penetration (BBB): | 0.874 | Plasma Protein Binding (PPB): | 70.24% |
| Volume Distribution (VD): | 0.658 | Fu: | 28.74% |
| CYP1A2-inhibitor: | 0.014 | CYP1A2-substrate: | 0.663 |
| CYP2C19-inhibitor: | 0.063 | CYP2C19-substrate: | 0.889 |
| CYP2C9-inhibitor: | 0.155 | CYP2C9-substrate: | 0.053 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.098 |
| CYP3A4-inhibitor: | 0.731 | CYP3A4-substrate: | 0.824 |
| Clearance (CL): | 6.586 | Half-life (T1/2): | 0.217 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.193 |
| Drug-inuced Liver Injury (DILI): | 0.709 | AMES Toxicity: | 0.036 |
| Rat Oral Acute Toxicity: | 0.792 | Maximum Recommended Daily Dose: | 0.436 |
| Skin Sensitization: | 0.06 | Carcinogencity: | 0.605 |
| Eye Corrosion: | 0.99 | Eye Irritation: | 0.408 |
| Respiratory Toxicity: | 0.973 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002012 | ![]() |
0.828 | D0H2MO | ![]() |
0.296 | ||
| ENC004115 | ![]() |
0.812 | D0V2JK | ![]() |
0.294 | ||
| ENC002033 | ![]() |
0.717 | D04GJN | ![]() |
0.287 | ||
| ENC003138 | ![]() |
0.673 | D0X7XG | ![]() |
0.279 | ||
| ENC005963 | ![]() |
0.649 | D0X4RS | ![]() |
0.273 | ||
| ENC003457 | ![]() |
0.631 | D03MTN | ![]() |
0.270 | ||
| ENC005965 | ![]() |
0.605 | D02CNR | ![]() |
0.267 | ||
| ENC005964 | ![]() |
0.561 | D02CJX | ![]() |
0.262 | ||
| ENC001980 | ![]() |
0.415 | D06AEO | ![]() |
0.260 | ||
| ENC001833 | ![]() |
0.392 | D0I2SD | ![]() |
0.256 | ||