|
Name |
surfactin A
|
| Molecular Formula | C51H89N7O13 | |
| IUPAC Name* |
3-[(3S,6R,9S,12S,15R,18S,21S,25R)-9-(carboxymethyl)-25-(8-methylnonyl)-3,6,15,18-tetrakis(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-12-propan-2-yl-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-21-yl]propanoic acid
|
|
| SMILES |
CC(C)CCCCCCC[C@@H]1CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)O1)CC(C)C)CC(C)C)CC(=O)O)C(C)C)CC(C)C)CC(C)C)CCC(=O)O
|
|
| InChI |
InChI=1S/C51H89N7O13/c1-28(2)18-16-14-13-15-17-19-34-26-41(59)52-35(20-21-42(60)61)45(64)53-36(22-29(3)4)46(65)55-38(24-31(7)8)49(68)58-44(33(11)12)50(69)56-39(27-43(62)63)48(67)54-37(23-30(5)6)47(66)57-40(25-32(9)10)51(70)71-34/h28-40,44H,13-27H2,1-12H3,(H,52,59)(H,53,64)(H,54,67)(H,55,65)(H,56,69)(H,57,66)(H,58,68)(H,60,61)(H,62,63)/t34-,35+,36+,37-,38-,39+,40+,44+/m1/s1
|
|
| InChIKey |
PBEDWPIWZYHNPL-RHKAOURMSA-N
|
|
| Synonyms |
surfactin A; 3-[(3S,6R,9S,12S,15R,18S,21S,25R)-9-(carboxymethyl)-3,6,15,18-tetraisobutyl-12-isopropyl-25-(8-methylnonyl)-2,5,8,11,14,17,20,23-octaoxo-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid; CHEBI:71976; J3.607.430B; Q27139838; Cyclo[L-Glu-L-Leu-D-Leu-L-Val-L-Asp-D-Leu-L-Leu-4-(7-methyloctyl)-2-deamino-D-aThr*-]
|
|
| CAS | NA | |
| PubChem CID | 70789014 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1008.3 | ALogp: | 7.7 |
| HBD: | 9 | HBA: | 13 |
| Rotatable Bonds: | 22 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 305.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 71 | QED Weighted: | 0.052 |
| Caco-2 Permeability: | -5.971 | MDCK Permeability: | 0.00004830 |
| Pgp-inhibitor: | 0.227 | Pgp-substrate: | 0.994 |
| Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.91 |
| 30% Bioavailability (F30%): | 0.839 |
| Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 94.03% |
| Volume Distribution (VD): | 0.37 | Fu: | 4.05% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.002 |
| CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.036 |
| CYP2C9-inhibitor: | 0.151 | CYP2C9-substrate: | 0.998 |
| CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.025 |
| CYP3A4-inhibitor: | 0.213 | CYP3A4-substrate: | 0.047 |
| Clearance (CL): | 2.081 | Half-life (T1/2): | 0.802 |
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.977 |
| Drug-inuced Liver Injury (DILI): | 0.294 | AMES Toxicity: | 0.003 |
| Rat Oral Acute Toxicity: | 0.069 | Maximum Recommended Daily Dose: | 0.945 |
| Skin Sensitization: | 0.158 | Carcinogencity: | 0.08 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
| Respiratory Toxicity: | 0.024 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001983 | ![]() |
0.969 | D0K7NQ | ![]() |
0.445 | ||
| ENC003254 | ![]() |
0.500 | D0J7XL | ![]() |
0.412 | ||
| ENC005273 | ![]() |
0.469 | D09OOV | ![]() |
0.383 | ||
| ENC001506 | ![]() |
0.450 | D0M1IO | ![]() |
0.363 | ||
| ENC003247 | ![]() |
0.443 | D07FEC | ![]() |
0.362 | ||
| ENC005275 | ![]() |
0.440 | D0Q3BV | ![]() |
0.361 | ||
| ENC002094 | ![]() |
0.433 | D0O3YF | ![]() |
0.333 | ||
| ENC005271 | ![]() |
0.426 | D0L9HX | ![]() |
0.330 | ||
| ENC003950 | ![]() |
0.424 | D05HPI | ![]() |
0.325 | ||
| ENC004731 | ![]() |
0.423 | D0M3FJ | ![]() |
0.297 | ||