![]() |
Name |
Solanine, hydrochloride
|
Molecular Formula | C45H74ClNO15 | |
IUPAC Name* |
2-[5-hydroxy-6-(hydroxymethyl)-2-[(10,14,16,20-tetramethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-en-7-yl)oxy]-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol;hydrochloride
|
|
SMILES |
CC1CCC2C(C3C(N2C1)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C.Cl
|
|
InChI |
InChI=1S/C45H73NO15.ClH/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42;/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3;1H
|
|
InChIKey |
QUYXLQVIGMPDII-UHFFFAOYSA-N
|
|
Synonyms |
SOLANINE; NSC35611; Solanine, hydrochloride; CHEMBL4297009; NSC-35611
|
|
CAS | 20562-02-1 | |
PubChem CID | 54605356 | |
ChEMBL ID | CHEMBL4297009 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 904.5 | ALogp: | 0.6 |
HBD: | 10 | HBA: | 16 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 241.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 62 | QED Weighted: | 0.154 |
Caco-2 Permeability: | -5.788 | MDCK Permeability: | 0.00022398 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.016 |
Human Intestinal Absorption (HIA): | 0.988 | 20% Bioavailability (F20%): | 0.093 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.085 | Plasma Protein Binding (PPB): | 79.85% |
Volume Distribution (VD): | 0.183 | Fu: | 9.59% |
CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.04 |
CYP2C19-inhibitor: | 0.001 | CYP2C19-substrate: | 0.209 |
CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.062 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.284 |
CYP3A4-inhibitor: | 0.001 | CYP3A4-substrate: | 0.207 |
Clearance (CL): | 0.593 | Half-life (T1/2): | 0.032 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.213 |
Drug-inuced Liver Injury (DILI): | 0.03 | AMES Toxicity: | 0.106 |
Rat Oral Acute Toxicity: | 0.931 | Maximum Recommended Daily Dose: | 0.84 |
Skin Sensitization: | 0.001 | Carcinogencity: | 0.085 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.001 |
Respiratory Toxicity: | 0.636 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC0049112 | ![]() |
0.444 | D07ORO | ![]() |
0.687 | ||
ENC002180 | ![]() |
0.438 | D0P2IT | ![]() |
0.456 | ||
ENC001889 | ![]() |
0.429 | D04RYU | ![]() |
0.453 | ||
ENC001769 | ![]() |
0.429 | D07TGN | ![]() |
0.435 | ||
ENC001894 | ![]() |
0.418 | D04MRG | ![]() |
0.423 | ||
ENC002655 | ![]() |
0.415 | D0P6IK | ![]() |
0.416 | ||
ENC002245 | ![]() |
0.413 | D07QQD | ![]() |
0.415 | ||
ENC001938 | ![]() |
0.407 | D0SL2V | ![]() |
0.410 | ||
ENC001939 | ![]() |
0.407 | D09HTS | ![]() |
0.402 | ||
ENC001933 | ![]() |
0.405 | D0A8RX | ![]() |
0.399 |