|
Name |
Ginsenoside rb1
|
| Molecular Formula | C54H92O23 | |
| IUPAC Name* |
(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2S)-2-[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-3-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-12-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-en-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
| SMILES |
CC(=CCC[C@@](C)([C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)O)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O)C
|
|
| InChI |
InChI=1S/C54H92O23/c1-23(2)10-9-14-54(8,77-48-44(69)40(65)37(62)29(74-48)22-70-46-42(67)38(63)34(59)26(19-55)71-46)24-11-16-53(7)33(24)25(58)18-31-51(5)15-13-32(50(3,4)30(51)12-17-52(31,53)6)75-49-45(41(66)36(61)28(21-57)73-49)76-47-43(68)39(64)35(60)27(20-56)72-47/h10,24-49,55-69H,9,11-22H2,1-8H3/t24-,25+,26+,27+,28+,29+,30-,31+,32-,33-,34+,35+,36+,37+,38-,39-,40-,41-,42+,43+,44+,45+,46+,47-,48-,49-,51-,52+,53+,54-/m0/s1
|
|
| InChIKey |
GZYPWOGIYAIIPV-JBDTYSNRSA-N
|
|
| Synonyms |
Ginsenoside rb1; Gynosaponin C; 41753-43-9; Gypenoside III; Sanchinoside E1; Arasaponin E1; Panax saponin E; Pseudoginsenoside D; ginsenoside-Rb1; Panaxsaponin E; (20S)-ginsenoside Rb1; CHEMBL501515; GRb 1; CHEBI:67989; Sanchinoside Rb1; 7413S0WMH6; Notoginsenoside Rb1; 2-O-beta-Glucopyranosyl-(3beta,12beta)-20-[(6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl beta-D-glucopyranoside; GinsenosideRb1; EINECS 255-532-8; MFCD00133367; Panaxoside Rb1; 2-O-beta-Glucopyranosyl-(3beta,12beta)-20-((6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy)-12-hydroxydammar-24-en-3-yl-beta-D-glucopyranoside; UNII-7413S0WMH6; Gypenoside cento; NSC-310103; NSC 310103; GSRb1; GS-Rb1; 20(S)-ginsenoside Rb1; Ginsenoside Rb1 - 94%; BIDD:ER0108; GINSENOSIDE RB1 [USP-RS]; GINSENOSIDE RB1 [WHO-DD]; DTXSID401316929; HMS3885O12; EX-A6786; HY-N0039; BDBM50317541; s3924; AKOS025311537; CCG-270640; CS-3829; DB06749; NCGC00347398-04; BS-32417; XG164977; C20713; 753G439; Q-100470; Ginsenoside Rb1, primary pharmaceutical reference standard; Ginsenoside Rb1, European Pharmacopoeia (EP) Reference Standard; (3beta,12beta)-20-[(6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside; (3beta,12beta)-20-{[6-O-(beta-D-glucopyranosyl)-beta-D-glucopyranosyl]oxy}-12-hydroxydammar-24-en-3-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside; .BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,12.BETA.)-20-((6-O-.BETA.-D-GLUCOPYRANOSYL-.BETA.-D-GLUCOPYRANOSYL)OXY)-12-HYDROXYDAMMAR-24-EN-3-YL 2-O-.BETA.-D-GLUCOPYRANOSYL-; 3beta-[beta-D-glucopyranosyl-(1->2)-beta-D glucopyranosyloxy]-20-[beta-D-glucopyranosyl-(1->2)-beta-D glucopyranosyloxy]dammar-24-en-12beta-ol; beta-D-Glucopyranoside, (3-beta,12-beta)-20-((6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy)-12-hydroxydammar-24-en-3-yl 2-O-beta-D-glucopyranosyl-; GINSENOSIDE RB1 (CONSTITUENT OF AMERICAN GINSENG, ASIAN GINSENG, AND TIENCHI GINSENG) [DSC]
|
|
| CAS | 41753-43-9 | |
| PubChem CID | 9898279 | |
| ChEMBL ID | CHEMBL501515 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1109.3 | ALogp: | 0.3 |
| HBD: | 15 | HBA: | 23 |
| Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 377.0 | Aromatic Rings: | 8 |
| Heavy Atoms: | 77 | QED Weighted: | 0.061 |
| Caco-2 Permeability: | -6.227 | MDCK Permeability: | 0.00021008 |
| Pgp-inhibitor: | 0.994 | Pgp-substrate: | 0.031 |
| Human Intestinal Absorption (HIA): | 0.999 | 20% Bioavailability (F20%): | 0.979 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.02 | Plasma Protein Binding (PPB): | 70.22% |
| Volume Distribution (VD): | -0.229 | Fu: | 11.65% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.042 |
| CYP2C19-inhibitor: | 0 | CYP2C19-substrate: | 0.067 |
| CYP2C9-inhibitor: | 0 | CYP2C9-substrate: | 0.003 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.045 |
| CYP3A4-inhibitor: | 0.004 | CYP3A4-substrate: | 0.003 |
| Clearance (CL): | 0.086 | Half-life (T1/2): | 0.769 |
| hERG Blockers: | 0.311 | Human Hepatotoxicity (H-HT): | 0.076 |
| Drug-inuced Liver Injury (DILI): | 0.003 | AMES Toxicity: | 0.056 |
| Rat Oral Acute Toxicity: | 0.071 | Maximum Recommended Daily Dose: | 0.001 |
| Skin Sensitization: | 0.902 | Carcinogencity: | 0.006 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.051 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002245 | ![]() |
0.976 | D0A8RX | ![]() |
0.495 | ||
| ENC001894 | ![]() |
0.894 | D0P2IT | ![]() |
0.485 | ||
| ENC002655 | ![]() |
0.856 | D07QQD | ![]() |
0.479 | ||
| ENC002180 | ![]() |
0.856 | D04MRG | ![]() |
0.473 | ||
| ENC001938 | ![]() |
0.712 | D07XBE | ![]() |
0.430 | ||
| ENC001939 | ![]() |
0.671 | D07ORO | ![]() |
0.376 | ||
| ENC000865 | ![]() |
0.531 | D0AD5C | ![]() |
0.336 | ||
| ENC001918 | ![]() |
0.491 | D07BSE | ![]() |
0.336 | ||
| ENC002246 | ![]() |
0.451 | D0P6IK | ![]() |
0.330 | ||
| ENC002797 | ![]() |
0.405 | D07TGN | ![]() |
0.325 | ||