![]() |
Name |
Sitogluside
|
Molecular Formula | C35H60O6 | |
IUPAC Name* |
(2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C(C)C
|
|
InChI |
InChI=1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1
|
|
InChIKey |
NPJICTMALKLTFW-OFUAXYCQSA-N
|
|
Synonyms |
Daucosterol; Sitogluside; 474-58-8; Eleutheroside A; Alexandrin; Daucosterin; Coriandrinol; beta-Sitosterol glucoside; BSSG; Sitoglusidum; Doursterol; Sterolin; WA 184; Daucosterine; EU-4906; beta-Daucosterol; AW 10; Eleutheroside A; NSC-165962; BSS-G; Sitogluside (USAN/INN); 3-beta-(beta-D-Glucopyranosyloxy)stigmast-5-ene; beta-sitosteryl-beta-D-glucopyranoside; .beta.-sitosterol-glucoside; CHEMBL506678; CHEBI:67554; Sitosterol-3-O-beta-D-glucoside; AW-10; U45VN859W3; (3beta)-stigmast-5-en-3-yl beta-D-glucopyranoside; WA-184; .beta.-D-Glucopyranoside, (3.beta.)-stigmast-5-en-3-yl; beta-sitosterol 3-O-beta-D-glucopyranoside; (-)-beta-Sitosterol-beta-D-glucopyranoside; D05848; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol; Sitoglusido; NSC165962; Sitosteryl glycoside; sitosterol glucuronide; Sitosterol D-glucoside; beta-Sitosteryl glucoside; AC1NX3NW; beta-sitosterol glucutonide; Sitogluside [USAN:INN]; Sitoglusidum [INN-Latin]; Sitoglusido [INN-Spanish]; beta-Sitosterol beta-D-Glucoside; beta-Sitosterol monoglucoside; UNII-U45VN859W3; beta-sitosterol-beta-D-glycoside; FT-0686600; CID5742590; NSC 165962; EU 4906; BRN 4359450; SITOGLUSIDE [INN]; O-glucosyl-beta-sitosterol; SITOGLUSIDE [USAN]; SureCN137210; 3beta-(beta-D-Glucopyranosyloxy)stigmast-5-ene; b-Sitosterol b-D-glucoside; beta-Sitosterol D-glucoside; Ambap474-58-8; C011015; SCHEMBL137210; sitosteryl 3-beta-D-glucoside; (3-beta)-Stigmast-5-en-3-yl-beta-D-glucopyranoside; DTXSID301045674; HY-N0410; 3-O-beta-D-glucosyl-beta-sitosterol; BDBM50257635; MFCD01683621; ZINC49888788; beta-sitosterol 3-O-beta-D-glucoside; beta-sitosterol-beta-D-glucopyranoside; AKOS032962016; CS-5421; .BETA.-SITOSTEROL-.BETA.-D-GLUCOSIDE; C20785; SITOSTEROL 3-O-.BETA.-D-GLUCOPYRANOSIDE; 474D588; Q-100502; Stigmast-5-ene, 3-beta-(beta-D-glucopyranosyloxy)-; beta-D-Glucopyranoside, (3beta)-stigmast-5-en-3-yl; Q15410900; 3.BETA.-(.BETA.-D-GLUCOPYRANOSYLOXY)STIGMAST-5-ENE; BETA-SITOSTEROL GLUCOSIDE (DAUCOSTEROL) (CONSTITUENT OF STINGING NETTLE) [DSC]; (2R,3R,4S,5S,6R)-2-((3S,8S,9S,10R,13R,14S,17R)-17-((2R,5R)-5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(1R,4R)-4-ethyl-1,5-dimethyl-hexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
|
|
CAS | 474-58-8 | |
PubChem CID | 5742590 | |
ChEMBL ID | CHEMBL506678 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 576.8 | ALogp: | 7.7 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 99.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 41 | QED Weighted: | 0.253 |
Caco-2 Permeability: | -4.793 | MDCK Permeability: | 0.00001170 |
Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.14 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.901 |
30% Bioavailability (F30%): | 0.038 |
Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 92.30% |
Volume Distribution (VD): | 1.125 | Fu: | 1.85% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.341 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.776 |
CYP2C9-inhibitor: | 0.124 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.118 |
CYP3A4-inhibitor: | 0.271 | CYP3A4-substrate: | 0.353 |
Clearance (CL): | 3.083 | Half-life (T1/2): | 0.131 |
hERG Blockers: | 0.891 | Human Hepatotoxicity (H-HT): | 0.163 |
Drug-inuced Liver Injury (DILI): | 0.179 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.005 | Maximum Recommended Daily Dose: | 0.049 |
Skin Sensitization: | 0.938 | Carcinogencity: | 0.098 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.099 |
Respiratory Toxicity: | 0.89 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001889 | ![]() |
0.794 | D0Y7LD | ![]() |
0.675 | ||
ENC001107 | ![]() |
0.675 | D07ORO | ![]() |
0.410 | ||
ENC001008 | ![]() |
0.675 | D0B4RU | ![]() |
0.394 | ||
ENC001647 | ![]() |
0.659 | D0M4WA | ![]() |
0.383 | ||
ENC000961 | ![]() |
0.582 | D04RYU | ![]() |
0.379 | ||
ENC004803 | ![]() |
0.559 | D0G3SH | ![]() |
0.357 | ||
ENC001475 | ![]() |
0.555 | D03ZTE | ![]() |
0.357 | ||
ENC000125 | ![]() |
0.553 | D0S0NK | ![]() |
0.344 | ||
ENC001942 | ![]() |
0.543 | D0K0EK | ![]() |
0.333 | ||
ENC001170 | ![]() |
0.540 | D0OR2L | ![]() |
0.324 |