|
Name |
Stigmasterol glucoside
|
| Molecular Formula | C35H58O6 | |
| IUPAC Name* |
(2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
| SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C(C)C
|
|
| InChI |
InChI=1S/C35H58O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h8-10,20-22,24-33,36-39H,7,11-19H2,1-6H3/b9-8+/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1
|
|
| InChIKey |
VWDLOXMZIGUBKM-AUGXRQBFSA-N
|
|
| Synonyms |
Stigmasterol glucoside; 19716-26-8; stigmasterol 3-O-beta-D-glucoside; CHEMBL447335; CHEBI:68383; stigmasterol 3-O-beta-D-glucopyranoside; Prosaponin; Stigmasterol 3-glucoside; stigmasteryl 3-beta-D-glucoside; DTXSID601289039; HY-N1200; BDBM50357395; ZINC49833002; 3-O-beta-D-glucopyranosylstigmasterol; AKOS037515192; Stigmasteryl-3-O-beta-D-glucopyranoside; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol; stigma-5,22-dien-3-beta-D-glucopyranoside; CS-0016492; Stigmasta-5,22-dien-3-O-.beta.-D-glucopyranoside; Q27136880; (3beta,22E)-stigmasta-5,22-dien-3-yl beta-D-glucopyranoside; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,1R,4S)-4-ethyl-1,5-dimethyl-hex-2-enyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
|
|
| CAS | 19716-26-8 | |
| PubChem CID | 6602508 | |
| ChEMBL ID | CHEMBL447335 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 574.8 | ALogp: | 7.0 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 99.4 | Aromatic Rings: | 5 |
| Heavy Atoms: | 41 | QED Weighted: | 0.274 |
| Caco-2 Permeability: | -4.857 | MDCK Permeability: | 0.00002580 |
| Pgp-inhibitor: | 0.975 | Pgp-substrate: | 0.771 |
| Human Intestinal Absorption (HIA): | 0.258 | 20% Bioavailability (F20%): | 0.933 |
| 30% Bioavailability (F30%): | 0.137 |
| Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 86.19% |
| Volume Distribution (VD): | 1.183 | Fu: | 1.34% |
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.398 |
| CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.771 |
| CYP2C9-inhibitor: | 0.11 | CYP2C9-substrate: | 0.038 |
| CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.151 |
| CYP3A4-inhibitor: | 0.507 | CYP3A4-substrate: | 0.585 |
| Clearance (CL): | 1.426 | Half-life (T1/2): | 0.113 |
| hERG Blockers: | 0.469 | Human Hepatotoxicity (H-HT): | 0.189 |
| Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.027 |
| Rat Oral Acute Toxicity: | 0.209 | Maximum Recommended Daily Dose: | 0.943 |
| Skin Sensitization: | 0.783 | Carcinogencity: | 0.089 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
| Respiratory Toxicity: | 0.956 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001769 | ![]() |
0.794 | D0Y7LD | ![]() |
0.519 | ||
| ENC001545 | ![]() |
0.675 | D07ORO | ![]() |
0.410 | ||
| ENC003369 | ![]() |
0.659 | D0B4RU | ![]() |
0.394 | ||
| ENC001846 | ![]() |
0.659 | D04RYU | ![]() |
0.379 | ||
| ENC004803 | ![]() |
0.652 | D0M4WA | ![]() |
0.336 | ||
| ENC004758 | ![]() |
0.582 | D0K0EK | ![]() |
0.333 | ||
| ENC001558 | ![]() |
0.582 | D0M2QH | ![]() |
0.331 | ||
| ENC002290 | ![]() |
0.540 | D0S0NK | ![]() |
0.327 | ||
| ENC003458 | ![]() |
0.531 | D0G8OC | ![]() |
0.322 | ||
| ENC004550 | ![]() |
0.520 | D0G3SH | ![]() |
0.319 | ||