|
Name |
Andrographidin B
|
| Molecular Formula | C23H24O12 | |
| IUPAC Name* |
5-hydroxy-2-[2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7,8-dimethoxychromen-4-one
|
|
| SMILES |
COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=C(C(=CC=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)OC
|
|
| InChI |
InChI=1S/C23H24O12/c1-31-14-7-11(26)16-10(25)6-13(33-22(16)21(14)32-2)9-4-3-5-12(17(9)27)34-23-20(30)19(29)18(28)15(8-24)35-23/h3-7,15,18-20,23-24,26-30H,8H2,1-2H3/t15-,18-,19+,20-,23-/m1/s1
|
|
| InChIKey |
JCUIPEIMZRLNKQ-BSTKLLGTSA-N
|
|
| Synonyms |
Andrographidin B; 113963-38-5; ZINC137599195; 5-hydroxy-2-[2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7,8-dimethoxychromen-4-one; NCGC00385204-01!5-hydroxy-2-[2-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7,8-dimethoxychromen-4-one
|
|
| CAS | NA | |
| PubChem CID | 11968627 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 492.4 | ALogp: | 0.8 |
| HBD: | 6 | HBA: | 12 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 185.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 35 | QED Weighted: | 0.279 |
| Caco-2 Permeability: | -6.141 | MDCK Permeability: | 0.00002300 |
| Pgp-inhibitor: | 0.065 | Pgp-substrate: | 0.782 |
| Human Intestinal Absorption (HIA): | 0.568 | 20% Bioavailability (F20%): | 0.007 |
| 30% Bioavailability (F30%): | 0.981 |
| Blood-Brain-Barrier Penetration (BBB): | 0.093 | Plasma Protein Binding (PPB): | 74.81% |
| Volume Distribution (VD): | 0.788 | Fu: | 21.55% |
| CYP1A2-inhibitor: | 0.065 | CYP1A2-substrate: | 0.795 |
| CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.133 |
| CYP2C9-inhibitor: | 0.026 | CYP2C9-substrate: | 0.267 |
| CYP2D6-inhibitor: | 0.064 | CYP2D6-substrate: | 0.207 |
| CYP3A4-inhibitor: | 0.074 | CYP3A4-substrate: | 0.048 |
| Clearance (CL): | 5.023 | Half-life (T1/2): | 0.803 |
| hERG Blockers: | 0.275 | Human Hepatotoxicity (H-HT): | 0.19 |
| Drug-inuced Liver Injury (DILI): | 0.962 | AMES Toxicity: | 0.755 |
| Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.005 |
| Skin Sensitization: | 0.175 | Carcinogencity: | 0.057 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.03 |
| Respiratory Toxicity: | 0.027 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001572 | ![]() |
0.516 | D0TC7C | ![]() |
0.439 | ||
| ENC001575 | ![]() |
0.512 | D06BQU | ![]() |
0.411 | ||
| ENC001532 | ![]() |
0.508 | D06GCK | ![]() |
0.410 | ||
| ENC001625 | ![]() |
0.505 | D0I9HF | ![]() |
0.390 | ||
| ENC004734 | ![]() |
0.500 | D0Z2LG | ![]() |
0.323 | ||
| ENC003752 | ![]() |
0.492 | D09LBS | ![]() |
0.323 | ||
| ENC004475 | ![]() |
0.480 | D07VLY | ![]() |
0.320 | ||
| ENC004073 | ![]() |
0.463 | D0C9XJ | ![]() |
0.320 | ||
| ENC003813 | ![]() |
0.447 | D0AZ8C | ![]() |
0.320 | ||
| ENC004797 | ![]() |
0.445 | D01XWG | ![]() |
0.301 | ||