![]() |
Name |
Gliocladinin C
|
Molecular Formula | C27H30O10 | |
IUPAC Name* |
(2S,3R,4S,5S,6R)-2-[2-hydroxy-4-methoxy-3,6-bis(4-methoxyphenyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
COC1=CC=C(C=C1)C2=CC(=C(C(=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)C4=CC=C(C=C4)OC)OC
|
|
InChI |
InChI=1S/C27H30O10/c1-33-16-8-4-14(5-9-16)18-12-19(35-3)21(15-6-10-17(34-2)11-7-15)23(30)26(18)37-27-25(32)24(31)22(29)20(13-28)36-27/h4-12,20,22,24-25,27-32H,13H2,1-3H3/t20-,22-,24+,25-,27+/m1/s1
|
|
InChIKey |
GHNRWYMFJLEBGF-PWRUQVKWSA-N
|
|
Synonyms |
Gliocladinin C
|
|
CAS | NA | |
PubChem CID | 146682828 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 514.5 | ALogp: | 2.6 |
HBD: | 5 | HBA: | 10 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 147.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 37 | QED Weighted: | 0.304 |
Caco-2 Permeability: | -5.892 | MDCK Permeability: | 0.00001860 |
Pgp-inhibitor: | 0.201 | Pgp-substrate: | 0.025 |
Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.138 |
Blood-Brain-Barrier Penetration (BBB): | 0.06 | Plasma Protein Binding (PPB): | 92.55% |
Volume Distribution (VD): | 0.519 | Fu: | 3.85% |
CYP1A2-inhibitor: | 0.172 | CYP1A2-substrate: | 0.853 |
CYP2C19-inhibitor: | 0.164 | CYP2C19-substrate: | 0.092 |
CYP2C9-inhibitor: | 0.294 | CYP2C9-substrate: | 0.858 |
CYP2D6-inhibitor: | 0.45 | CYP2D6-substrate: | 0.923 |
CYP3A4-inhibitor: | 0.32 | CYP3A4-substrate: | 0.258 |
Clearance (CL): | 7.259 | Half-life (T1/2): | 0.327 |
hERG Blockers: | 0.502 | Human Hepatotoxicity (H-HT): | 0.104 |
Drug-inuced Liver Injury (DILI): | 0.916 | AMES Toxicity: | 0.39 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.227 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
Respiratory Toxicity: | 0.042 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005871 | ![]() |
0.600 | D08DFX | ![]() |
0.397 | ||
ENC005870 | ![]() |
0.600 | D01TNW | ![]() |
0.371 | ||
ENC002952 | ![]() |
0.557 | D0TC7C | ![]() |
0.353 | ||
ENC000826 | ![]() |
0.504 | D06BQU | ![]() |
0.350 | ||
ENC004476 | ![]() |
0.496 | D06ALD | ![]() |
0.345 | ||
ENC005869 | ![]() |
0.492 | D0I9HF | ![]() |
0.331 | ||
ENC002201 | ![]() |
0.463 | D06LOQ | ![]() |
0.310 | ||
ENC001625 | ![]() |
0.460 | D0AZ8C | ![]() |
0.297 | ||
ENC004475 | ![]() |
0.454 | D06GCK | ![]() |
0.293 | ||
ENC005039 | ![]() |
0.446 | D0Z2LG | ![]() |
0.276 |