![]() |
Name |
1-O-methyl-6-O-(alpha-D-ribofuranosyl)emodin
|
Molecular Formula | C21H20O9 | |
IUPAC Name* |
3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-1-hydroxy-8-methoxy-6-methylanthracene-9,10-dione
|
|
SMILES |
CC1=CC2=C(C(=C1)OC)C(=O)C3=C(C2=O)C=C(C=C3O)O[C@@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O
|
|
InChI |
InChI=1S/C21H20O9/c1-8-3-10-16(13(4-8)28-2)19(26)15-11(17(10)24)5-9(6-12(15)23)29-21-20(27)18(25)14(7-22)30-21/h3-6,14,18,20-23,25,27H,7H2,1-2H3/t14-,18-,20-,21+/m1/s1
|
|
InChIKey |
YSOKOLXNOPRZHN-STCFGPAYSA-N
|
|
Synonyms |
1-O-methyl-6-O-(alpha-D-ribofuranosyl)emodin
|
|
CAS | NA | |
PubChem CID | 139589439 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 416.4 | ALogp: | 1.9 |
HBD: | 4 | HBA: | 9 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 143.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.483 |
Caco-2 Permeability: | -5.868 | MDCK Permeability: | 0.00001210 |
Pgp-inhibitor: | 0.614 | Pgp-substrate: | 0.891 |
Human Intestinal Absorption (HIA): | 0.708 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.105 | Plasma Protein Binding (PPB): | 88.12% |
Volume Distribution (VD): | 0.649 | Fu: | 3.45% |
CYP1A2-inhibitor: | 0.522 | CYP1A2-substrate: | 0.397 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.083 |
CYP2C9-inhibitor: | 0.158 | CYP2C9-substrate: | 0.117 |
CYP2D6-inhibitor: | 0.168 | CYP2D6-substrate: | 0.176 |
CYP3A4-inhibitor: | 0.345 | CYP3A4-substrate: | 0.124 |
Clearance (CL): | 8.442 | Half-life (T1/2): | 0.245 |
hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.056 |
Drug-inuced Liver Injury (DILI): | 0.934 | AMES Toxicity: | 0.898 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.19 |
Skin Sensitization: | 0.11 | Carcinogencity: | 0.934 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.694 |
Respiratory Toxicity: | 0.053 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002031 | ![]() |
0.598 | D0I9HF | ![]() |
0.379 | ||
ENC000939 | ![]() |
0.580 | D0TC7C | ![]() |
0.357 | ||
ENC000362 | ![]() |
0.562 | D07VLY | ![]() |
0.333 | ||
ENC002107 | ![]() |
0.533 | D0C9XJ | ![]() |
0.333 | ||
ENC005602 | ![]() |
0.527 | D0AZ8C | ![]() |
0.333 | ||
ENC000913 | ![]() |
0.527 | D06BQU | ![]() |
0.330 | ||
ENC001971 | ![]() |
0.527 | D01XWG | ![]() |
0.321 | ||
ENC003752 | ![]() |
0.514 | D0Z2LG | ![]() |
0.306 | ||
ENC001497 | ![]() |
0.511 | D09LBS | ![]() |
0.306 | ||
ENC004797 | ![]() |
0.510 | D0N1FS | ![]() |
0.292 |