|
Name |
Gossypin
|
| Molecular Formula | C21H20O13 | |
| IUPAC Name* |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
|
|
| SMILES |
C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O
|
|
| InChI |
InChI=1S/C21H20O13/c22-5-11-13(27)15(29)17(31)21(32-11)34-19-10(26)4-9(25)12-14(28)16(30)18(33-20(12)19)6-1-2-7(23)8(24)3-6/h1-4,11,13,15,17,21-27,29-31H,5H2/t11-,13-,15+,17-,21+/m1/s1
|
|
| InChIKey |
SJRXVLUZMMDCNG-KKPQBLLMSA-N
|
|
| Synonyms |
Gossypin; 652-78-8; Gossypetin-8-glucoside; NSC 656276; BRN 0071526; Gossypetin 8-O-glucoside; A3Q367XWX9; CHEBI:5525; 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one; 3,5,7,8,3',4'-Hexahydroxyflavone-8-glucoside; Gossypetin 8-glucoside; 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-chromen-4-one; 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-8-(.beta.-D-glucopyranosyloxy)-3,5,7-trihydroxy-; UNII-A3Q367XWX9; Gossypin (4); MFCD00017429; ST057186; 2-(3,4-Dihydroxyphenyl)-8-(beta-D-glucopyranosyloxy)-3,5,7-trihydroxy-4H-1-benzopyran-4-one; 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-8-(beta-D-glucopyranosyloxy)-3,5,7-trihydroxy-; 4-18-00-03589 (Beilstein Handbook Reference); CHEMBL402915; SCHEMBL1156121; Gossypin, >=90% (HPLC); DTXSID60215512; BDBM153264; ZINC4098515; AKOS024282592; HY-125911; CS-0102990; C10051; 3,3',4',5,7,8-Hexahydroxyflavone-8-glucoside; A1-00786; BRD-K05485208-001-01-1; Q27106791; 3,3',4',5,7,8-HEXAHYDROXYFLAVONE 8-GLUCOSIDE; 2-(3,4-Dihydroxy-phenyl)-3,5,7-trihydroxy-8-(3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-chromen-4-one; 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-4H-1-benzopyran-8-yl beta-D-glucopyranoside; 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)-4H-chromen-4-one
|
|
| CAS | 652-78-8 | |
| PubChem CID | 5281621 | |
| ChEMBL ID | CHEMBL402915 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 480.4 | ALogp: | 0.0 |
| HBD: | 9 | HBA: | 13 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 227.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 34 | QED Weighted: | 0.218 |
| Caco-2 Permeability: | -6.403 | MDCK Permeability: | 0.00000783 |
| Pgp-inhibitor: | 0.034 | Pgp-substrate: | 0.194 |
| Human Intestinal Absorption (HIA): | 0.573 | 20% Bioavailability (F20%): | 0.027 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 90.19% |
| Volume Distribution (VD): | 0.759 | Fu: | 15.69% |
| CYP1A2-inhibitor: | 0.158 | CYP1A2-substrate: | 0.038 |
| CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.042 |
| CYP2C9-inhibitor: | 0.057 | CYP2C9-substrate: | 0.104 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.132 |
| CYP3A4-inhibitor: | 0.045 | CYP3A4-substrate: | 0.006 |
| Clearance (CL): | 4.821 | Half-life (T1/2): | 0.932 |
| hERG Blockers: | 0.229 | Human Hepatotoxicity (H-HT): | 0.245 |
| Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.868 |
| Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.005 |
| Skin Sensitization: | 0.887 | Carcinogencity: | 0.039 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.791 |
| Respiratory Toxicity: | 0.021 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004734 | ![]() |
0.717 | D0K8KX | ![]() |
0.490 | ||
| ENC001575 | ![]() |
0.627 | D06BQU | ![]() |
0.374 | ||
| ENC001546 | ![]() |
0.548 | D0TC7C | ![]() |
0.369 | ||
| ENC002201 | ![]() |
0.516 | D04AIT | ![]() |
0.364 | ||
| ENC001532 | ![]() |
0.513 | D0I9HF | ![]() |
0.346 | ||
| ENC004475 | ![]() |
0.508 | D0AZ8C | ![]() |
0.310 | ||
| ENC001529 | ![]() |
0.490 | D09LBS | ![]() |
0.310 | ||
| ENC004476 | ![]() |
0.431 | D0Z2LG | ![]() |
0.310 | ||
| ENC004797 | ![]() |
0.422 | D08DFX | ![]() |
0.297 | ||
| ENC002582 | ![]() |
0.417 | D01TNW | ![]() |
0.288 | ||