|
Name |
Phomopyrone A
|
| Molecular Formula | C11H14O4 | |
| IUPAC Name* |
6-[(E)-but-2-en-2-yl]-3-(hydroxymethyl)-4-methoxypyran-2-one
|
|
| SMILES |
C/C=C(\C)/C1=CC(=C(C(=O)O1)CO)OC
|
|
| InChI |
InChI=1S/C11H14O4/c1-4-7(2)9-5-10(14-3)8(6-12)11(13)15-9/h4-5,12H,6H2,1-3H3/b7-4+
|
|
| InChIKey |
WLPQYAGDMJKPTN-QPJJXVBHSA-N
|
|
| Synonyms |
Phomopyrone A
|
|
| CAS | NA | |
| PubChem CID | 139591591 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 210.23 | ALogp: | 1.8 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 15 | QED Weighted: | 0.83 |
| Caco-2 Permeability: | -4.707 | MDCK Permeability: | 0.00002520 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.045 |
| Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.89 |
| Blood-Brain-Barrier Penetration (BBB): | 0.538 | Plasma Protein Binding (PPB): | 75.11% |
| Volume Distribution (VD): | 0.898 | Fu: | 42.61% |
| CYP1A2-inhibitor: | 0.925 | CYP1A2-substrate: | 0.94 |
| CYP2C19-inhibitor: | 0.23 | CYP2C19-substrate: | 0.67 |
| CYP2C9-inhibitor: | 0.089 | CYP2C9-substrate: | 0.738 |
| CYP2D6-inhibitor: | 0.029 | CYP2D6-substrate: | 0.803 |
| CYP3A4-inhibitor: | 0.023 | CYP3A4-substrate: | 0.264 |
| Clearance (CL): | 6.312 | Half-life (T1/2): | 0.906 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.3 |
| Drug-inuced Liver Injury (DILI): | 0.567 | AMES Toxicity: | 0.022 |
| Rat Oral Acute Toxicity: | 0.066 | Maximum Recommended Daily Dose: | 0.029 |
| Skin Sensitization: | 0.237 | Carcinogencity: | 0.204 |
| Eye Corrosion: | 0.012 | Eye Irritation: | 0.688 |
| Respiratory Toxicity: | 0.076 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001650 | ![]() |
0.674 | D0E9CD | ![]() |
0.250 | ||
| ENC003737 | ![]() |
0.632 | D06REO | ![]() |
0.238 | ||
| ENC003510 | ![]() |
0.600 | D05QDC | ![]() |
0.224 | ||
| ENC003261 | ![]() |
0.519 | D08VYV | ![]() |
0.221 | ||
| ENC002477 | ![]() |
0.519 | D02XJY | ![]() |
0.219 | ||
| ENC003181 | ![]() |
0.518 | D03LGG | ![]() |
0.217 | ||
| ENC004632 | ![]() |
0.517 | D0U5CE | ![]() |
0.217 | ||
| ENC004631 | ![]() |
0.517 | D09GYT | ![]() |
0.212 | ||
| ENC004630 | ![]() |
0.517 | D06GCK | ![]() |
0.211 | ||
| ENC003751 | ![]() |
0.500 | D0B1IP | ![]() |
0.209 | ||